CAS 539-93-5: 1,3-Dilaurin
Description:1,3-Dilaurin, also known as 1,3-dodecanediol, is a diester derived from lauric acid, which is a saturated fatty acid. It is characterized by its chemical structure, featuring two lauric acid chains attached to a glycerol backbone at the 1 and 3 positions. This compound is typically a white, waxy solid at room temperature and is insoluble in water but soluble in organic solvents such as ethanol and chloroform. 1,3-Dilaurin is known for its emulsifying properties, making it useful in food, cosmetic, and pharmaceutical formulations. It exhibits low toxicity and is generally recognized as safe for use in various applications. Additionally, it has potential antimicrobial properties, which can enhance the preservation of products. Its stability under various conditions makes it a valuable ingredient in formulations requiring a longer shelf life. Overall, 1,3-Dilaurin serves as an important compound in both industrial and consumer products due to its functional characteristics.
Formula:C27H52O5
InChI:InChI=1S/C27H52O5/c1-3-5-7-9-11-13-15-17-19-21-26(29)31-23-25(28)24-32-27(30)22-20-18-16-14-12-10-8-6-4-2/h25,28H,3-24H2,1-2H3
InChI key:InChIKey=KUVAEMGNHJQSMH-UHFFFAOYSA-N
SMILES:O=C(OCC(O)COC(=O)CCCCCCCCCCC)CCCCCCCCCCC
- Synonyms:
- (3-Dodecanoyloxy-2-hydroxypropyl) dodecanoate
- 1,3-Dilaurin
- 1,3-Dilauroylglycerol
- 2-Hydroxypropane-1,3-Diyl Didodecanoate
- Diluarin
- Dodecanoic acid, 1,1′-(2-hydroxy-1,3-propanediyl) ester
- Dodecanoic acid, 2-hydroxy-1,3-propanediyl ester
- Glycerol 1,3-didodecanoate
- Glycerol 1,3-dilaurate
- Laurin, 1,3-di-
- See more synonyms
- alpha,alpha-Diluarin
- α,α′-Dilaurin