CAS 539-98-0

4-Hydroxy-5,6-undecadiene-8,10-diynoic acid

Description:

4-Hydroxy-5,6-undecadiene-8,10-diynoic acid, with the CAS number 539-98-0, is an organic compound characterized by its unique structure featuring multiple unsaturated bonds, specifically two alkyne groups and a hydroxyl group. This compound belongs to the class of fatty acids and is notable for its conjugated diene and diynoic acid functionalities, which contribute to its reactivity and potential applications in organic synthesis and materials science. The presence of the hydroxyl group enhances its solubility in polar solvents and may influence its biological activity. Additionally, the compound's structure suggests potential for various chemical reactions, including polymerization and functionalization, making it of interest in the development of novel materials. Its stability and reactivity can be influenced by environmental factors such as pH and temperature. Overall, 4-Hydroxy-5,6-undecadiene-8,10-diynoic acid is a versatile compound with implications in both synthetic chemistry and potential biological applications.

Formula: C₁₁H₁₀O₃

InChI: InChI=1/C11H10O3/c1-2-3-4-5-6-7-10(12)8-9-11(13)14/h1,5,7,10,12H,8-9H2,(H,13,14)

Synonyms:

• Nemotinic acid
• 5,6-Undecadiene-8,10-diynoic acid, 4-hydroxy- (7CI,8CI,9CI)
• 4-Hydroxy-5,6-undecadiene-8,10-diynoic acid

Nemotinic acid

CAS: 539-98-0

Nemotinic acid exhibits activity against Gram-positive bacteria, mycobacteria, and fungi, while also displaying weaker activity against Gram-negative bacteria.

Formula: C₁₁H₁₀O₃

Color and Shape: Solid

Molecular weight: 190.195

Ref: TM-TN10111