CymitQuimica logo

CAS 53902-76-4

:

Pyrazolo[1,5-a]pyrazine-3-carboxylic acid

Description:
Pyrazolo[1,5-a]pyrazine-3-carboxylic acid is a heterocyclic organic compound characterized by a fused pyrazole structure. It features a carboxylic acid functional group at the 3-position of the pyrazine ring, which contributes to its acidic properties. This compound is typically a white to off-white solid and is soluble in polar solvents, reflecting its ability to engage in hydrogen bonding due to the presence of the carboxylic acid group. Pyrazolo[1,5-a]pyrazine derivatives are of interest in medicinal chemistry due to their potential biological activities, including anti-inflammatory and antitumor properties. The compound's structure allows for various substitutions, which can influence its reactivity and biological interactions. Additionally, its unique bicyclic framework makes it a valuable scaffold for the development of novel pharmaceuticals. As with many heterocycles, the stability and reactivity of pyrazolo[1,5-a]pyrazine-3-carboxylic acid can be influenced by environmental factors such as pH and temperature, making it a subject of interest in both synthetic and medicinal chemistry research.
Formula:C7H5N3O2
InChI:InChI=1S/C7H5N3O2/c11-7(12)5-3-9-10-2-1-8-4-6(5)10/h1-4H,(H,11,12)
InChI key:InChIKey=KDZOHLVVUNZUQC-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=C2N(N=C1)C=CN=C2
Synonyms:
  • Pyrazolo[1,5-a]pyrazine-3-carboxylic acid
Found 5 products.