CAS 53903-49-4
:2-Amino-5-methoxybenzotrifluoride
Description:
2-Amino-5-methoxybenzotrifluoride, with the CAS number 53903-49-4, is an organic compound characterized by the presence of an amino group, a methoxy group, and three fluorine atoms attached to a benzene ring. This compound features a benzotrifluoride structure, which contributes to its unique chemical properties. The amino group (-NH2) is a basic functional group that can participate in various chemical reactions, including nucleophilic substitutions and coupling reactions. The methoxy group (-OCH3) enhances the compound's solubility in organic solvents and can influence its reactivity and stability. The trifluoromethyl groups (-CF3) are known for their electron-withdrawing effects, which can significantly affect the compound's electronic properties and reactivity. Overall, 2-Amino-5-methoxybenzotrifluoride is of interest in various fields, including pharmaceuticals and agrochemicals, due to its potential applications in synthesis and as an intermediate in the production of more complex molecules. Its specific physical and chemical properties, such as melting point, boiling point, and solubility, would need to be referenced from detailed chemical databases or literature for precise information.
Formula:C8H8F3NO
InChI:InChI=1/C8H8F3NO/c1-13-5-2-3-7(12)6(4-5)8(9,10)11/h2-4H,12H2,1H3
SMILES:COc1ccc(c(c1)C(F)(F)F)N
Synonyms:- 4-Methoxy-2-(Trifluoromethyl)Aniline
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
2-AMINO-5-METHOXYBENZOTRIFLUORIDE
CAS:Formula:C8H8F3NOPurity:98%Color and Shape:LiquidMolecular weight:191.15042-Amino-5-methoxybenzotrifluoride
CAS:2-Amino-5-methoxybenzotrifluorideFormula:C8H8F3NOPurity:98%Color and Shape:Orange LiquidMolecular weight:191.15g/mol4-Methoxy-2-(trifluoromethyl)aniline
CAS:4-Methoxy-2-(trifluoromethyl)aniline is a chemical compound that is used as a research chemical, reagent, and speciality chemical. It is a versatile building block that can be used in reactions to produce complex compounds. 4-Methoxy-2-(trifluoromethyl)aniline has been identified by the Chemical Abstracts Service (CAS) as having high quality and is useful for preparing fine chemicals. This substance also has uses in the field of medicinal chemistry and can be used as a scaffold for pharmaceutical products.Formula:C8H8F3NOPurity:Min. 95%Color and Shape:Clear LiquidMolecular weight:191.15 g/mol4-Methoxy-2-(trifluoromethyl)aniline
CAS:Formula:C8H8F3NOPurity:98%Color and Shape:LiquidMolecular weight:191.153



