
CAS 53905-29-6
:2′,5′-Dichloro[1,1′-biphenyl]-3-ol
Description:
2′,5′-Dichloro[1,1′-biphenyl]-3-ol, with the CAS number 53905-29-6, is an organic compound characterized by its biphenyl structure substituted with two chlorine atoms and a hydroxyl group. This compound typically exhibits a solid state at room temperature and is known for its potential applications in various fields, including agrochemicals and pharmaceuticals. The presence of chlorine atoms enhances its reactivity and may influence its biological activity, making it of interest in toxicological studies. The hydroxyl group contributes to its polarity, affecting its solubility in different solvents. Additionally, the compound's structural features may impart specific properties such as stability under certain conditions and potential interactions with biological systems. Safety data sheets should be consulted for handling and toxicity information, as halogenated compounds can pose environmental and health risks. Overall, 2′,5′-Dichloro[1,1′-biphenyl]-3-ol is a notable compound within the realm of organic chemistry due to its unique structural characteristics and potential applications.
Formula:C12H8Cl2O
InChI:InChI=1S/C12H8Cl2O/c13-9-4-5-12(14)11(7-9)8-2-1-3-10(15)6-8/h1-7,15H
InChI key:InChIKey=MRRLNQOPCMALNK-UHFFFAOYSA-N
SMILES:ClC1=C(C2=CC(O)=CC=C2)C=C(Cl)C=C1
Synonyms:- 3-Hydroxy-2′,5′-dichlorobiphenyl
- 2′,5′-Dichloro[1,1′-biphenyl]-3-ol
- [1,1′-Biphenyl]-3-ol, 2′,5′-dichloro-
- 2′,5′-Dichloro-3-biphenylol
- 2,5-Dichlorobiphenyl-3′-ol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.