CAS 5391-17-3
:Glucopyranoside, isopropyl
Description:
Glucopyranoside, isopropyl, with the CAS number 5391-17-3, is a glycoside derived from glucose. It features a glucopyranose ring, which is a six-membered cyclic form of glucose, and isopropyl as the aglycone part. This compound is characterized by its solubility in organic solvents and limited solubility in water, typical of many glycosides. It exhibits properties such as sweetness, which is common among sugar derivatives, and may participate in various chemical reactions due to the presence of hydroxyl groups on the glucose moiety. The isopropyl group contributes to its hydrophobic characteristics, influencing its interaction with biological systems and potential applications in pharmaceuticals and food industries. Additionally, glucopyranosides can serve as intermediates in the synthesis of more complex molecules, making them valuable in organic chemistry. Safety data indicates that, like many glycosides, it should be handled with care, as it may have biological activity or toxicity depending on the context of use.
Formula:C9H18O6
InChI:InChI=1S/C9H18O6/c1-4(2)14-9-8(13)7(12)6(11)5(3-10)15-9/h4-13H,3H2,1-2H3/t5-,6-,7+,8-,9-/m1/s1
InChI key:InChIKey=UOEFDXYUEPHESS-SYHAXYEDSA-N
SMILES:O(C(C)C)[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O
Synonyms:- Isopropyl β-D-glucopyranoside
- Glucopyranoside, isopropyl, β-D-
- 1-Methylethyl β-D-glucopyranoside
- Glucopyranoside, isopropyl
- β-D-Glucopyranoside, 1-methylethyl
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
Isopropyl beta-D-glucopyranoside
CAS:Isopropylbeta-D-glucopyranoside is a chemical compound that has been studied for its antibacterial activity. It has been shown to inhibit the growth of bacteria by reacting with fatty acids in the cell membrane, which leads to the disruption of the cell membrane and death. Isopropylbeta-D-glucopyranoside is a member of the sugar alcohols class, and it can be synthesized from glucose, fatty acid, and hydrochloric acid using an acid catalyst. The reaction system is typically carried out in microcapsules.
Formula:C9H18O6Purity:Min. 95%Color and Shape:PowderMolecular weight:222.24 g/molRef: 3D-FI152923
Discontinued product
