CAS 5391-92-4
:P,P,P′,P′-Tetraethyl P,P′-1,6-hexanediylbis[phosphonate]
Description:
P,P,P′,P′-Tetraethyl P,P′-1,6-hexanediylbis[phosphonate], with CAS number 5391-92-4, is an organophosphorus compound characterized by its phosphonate functional groups. This substance typically appears as a colorless to pale yellow liquid or solid, depending on its purity and specific formulation. It is known for its applications in various fields, including agriculture as a pesticide and in chemical synthesis as a reagent. The compound features a hexanediyl backbone, which contributes to its structural stability and reactivity. Its phosphonate groups are known for their ability to form stable complexes with metal ions, making it useful in coordination chemistry. Additionally, P,P,P′,P′-Tetraethyl P,P′-1,6-hexanediylbis[phosphonate] may exhibit moderate toxicity, necessitating careful handling and adherence to safety protocols during use. Overall, its unique chemical structure and properties make it a valuable compound in both industrial and research applications.
Formula:C14H32O6P2
InChI:InChI=1S/C14H32O6P2/c1-5-17-21(15,18-6-2)13-11-9-10-12-14-22(16,19-7-3)20-8-4/h5-14H2,1-4H3
InChI key:InChIKey=VFUQGLDSIBJREL-UHFFFAOYSA-N
SMILES:P(CCCCCCP(OCC)(OCC)=O)(OCC)(OCC)=O
Synonyms:- NSC 3228
- 1,6-Bis(diethoxyphosphoryl)hexane
- Phosphonic acid, P,P′-1,6-hexanediylbis-, P,P,P′,P′-tetraethyl ester
- P,P,P′,P′-Tetraethyl P,P′-1,6-hexanediylbis[phosphonate]
- Phosphonic acid, 1,6-hexanediylbis-, tetraethyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Tetraethyl hexane-1,6-diylbis(phosphonate)
CAS:Tetraethyl hexane-1,6-diylbis(phosphonate)
Molecular weight:358.35g/mol
