CAS 53929-75-2: N2-Butyl-2,3-pyridinediamine

Description:N2-Butyl-2,3-pyridinediamine, with the CAS number 53929-75-2, is an organic compound characterized by its pyridine ring structure substituted with two amino groups and a butyl chain. This compound typically exhibits properties associated with amines, such as basicity and the ability to form hydrogen bonds, which can influence its solubility in various solvents. It is likely to be a colorless to pale yellow liquid or solid, depending on its specific form and purity. The presence of the pyridine ring contributes to its aromatic character, while the butyl group enhances its hydrophobic properties. N2-Butyl-2,3-pyridinediamine may be utilized in various applications, including as a ligand in coordination chemistry, in the synthesis of pharmaceuticals, or as an intermediate in organic synthesis. Safety data sheets should be consulted for handling and storage guidelines, as amines can be hazardous and may require appropriate safety measures.

Formula:C₉H₁₅N₃

InChI:InChI=1S/C9H15N3/c1-2-3-6-11-9-8(10)5-4-7-12-9/h4-5,7H,2-3,6,10H2,1H3,(H,11,12)

InChI key:InChIKey=NQPVPVUORROSIB-UHFFFAOYSA-N

SMILES:N=1C=CC=C(N)C1NCCCC