CymitQuimica logo

CAS 53933-47-4

:

(S)-1-Phenylethylhydroxylamine

Description:
(S)-1-Phenylethylhydroxylamine, with the CAS number 53933-47-4, is an organic compound characterized by its hydroxylamine functional group attached to a phenylethyl moiety. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its form and purity. It is known for its role in organic synthesis, particularly in the formation of oximes from carbonyl compounds, and can serve as a chiral auxiliary in asymmetric synthesis due to its stereogenic center. The presence of the hydroxylamine group imparts reactivity, allowing it to participate in various chemical reactions, including nucleophilic attacks and condensation reactions. Additionally, (S)-1-Phenylethylhydroxylamine may exhibit biological activity, making it of interest in medicinal chemistry. Its solubility in polar solvents and stability under standard laboratory conditions further enhance its utility in synthetic applications. As with many organic compounds, proper handling and safety precautions are essential due to potential hazards associated with its reactivity and toxicity.
Formula:C8H11NO
InChI:InChI=1/C8H11NO/c1-7(9-10)8-5-3-2-4-6-8/h2-7,9-10H,1H3/t7-/m0/s1
SMILES:C[C@@H](c1ccccc1)NO
Synonyms:
  • (1S)-N-Hydroxy-1-phenylethanamine
  • benzenemethanamine, N-hydroxy-alpha-methyl-, (alphaS)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.