CymitQuimica logo

CAS 53934-76-2

:

2-Oxo-1-pyrrolidineacetic acid

Description:
2-Oxo-1-pyrrolidineacetic acid, also known by its CAS number 53934-76-2, is a chemical compound characterized by its pyrrolidine ring structure, which is a five-membered nitrogen-containing heterocycle. This compound features a ketone functional group (the "2-oxo" part) and a carboxylic acid group, contributing to its acidic properties. It is typically a white to off-white solid and is soluble in polar solvents, such as water and alcohols, due to the presence of the carboxylic acid group. The compound is of interest in various fields, including medicinal chemistry, where it may serve as a building block for the synthesis of biologically active molecules. Its structural features allow for potential interactions with biological systems, making it a candidate for further research in drug development. Additionally, the presence of the pyrrolidine ring may impart unique conformational and electronic properties, influencing its reactivity and interactions with other chemical entities.
Formula:C6H9NO3
InChI:InChI=1S/C6H9NO3/c8-5-2-1-3-7(5)4-6(9)10/h1-4H2,(H,9,10)
InChI key:InChIKey=JGPIWNNFLKDTSR-UHFFFAOYSA-N
SMILES:C(C(O)=O)N1C(=O)CCC1
Synonyms:
  • 1-Pyrrolidineacetic acid, 2-oxo-
  • 2-Oxo-1-pyrrolidineacetic acid
  • 2-Pyrrolidinon-1-ylacetic acid
  • 2-Pyrrolidinoneacetic acid
  • (2-Oxopyrrolidin-1-yl)acetic acid
Found 12 products.