CAS 5394-13-8
:2-bromo-1-benzothiophene
Description:
2-Bromo-1-benzothiophene is an organic compound characterized by its unique structure, which consists of a benzothiophene core substituted with a bromine atom at the second position. This compound features a fused ring system that includes a five-membered thiophene ring and a six-membered benzene ring, contributing to its aromatic properties. The presence of the bromine substituent enhances its reactivity, making it useful in various chemical reactions, including electrophilic substitutions and cross-coupling reactions. 2-Bromo-1-benzothiophene is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. Its applications span across organic synthesis, materials science, and potentially in the development of pharmaceuticals due to its structural characteristics. Additionally, the compound's properties, such as melting point, boiling point, and spectral characteristics, can vary based on purity and environmental conditions. As with many brominated compounds, it is essential to handle 2-bromo-1-benzothiophene with care due to potential environmental and health impacts associated with bromine-containing substances.
Formula:C8H5BrS
InChI:InChI=1/C8H5BrS/c9-8-5-6-3-1-2-4-7(6)10-8/h1-5H
SMILES:c1ccc2c(c1)cc(Br)s2
Synonyms:- Benzo(b)thiophene, 2-bromo-
- 2-Bromobenzo[B]Thiophene
- 2-Bromo-1-benzothiophene
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
2-Bromobenzo[b]thiophene
CAS:2-Bromobenzo[b]thiopheneFormula:C8H5BrSPurity:99%Color and Shape:White SolidMolecular weight:213.094292-Bromobenzo[b]thiophene
CAS:2-Bromobenzo[b]thiopheneFormula:C8H5BrSPurity:96% (stabilized with Cu+HQ+MgO)Molecular weight:213.092-Bromobenzothiophene
CAS:2-Bromobenzothiophene (BBT) is a synthetic molecule that has potent inhibitory activity against several biological targets, including hydroxy group, enantiomer and enhancement. BBT has been shown to have anticancer properties in vitro and in vivo. This compound also exhibits anti-inflammatory activities, which may be mediated by the inhibition of inflammatory cytokines such as IL-6, IL-8 and TNF-α. This heterocycle inhibits estradiol binding to estrogen receptors by competitive inhibition. The hydroxyl group on 2-bromobenzothiophene can form a covalent bond with thiols, which are abundant in proteins involved in inflammation. It also reacts with other reactive functional groups such as carbonyl groups or aromatic hydrocarbons.
Formula:C8H5BrSPurity:Min. 95%Molecular weight:213.09 g/mol




