CAS 5394-18-3
:2-(4-Bromobutyl)-1H-isoindole-1,3(2H)-dione
Description:
2-(4-Bromobutyl)-1H-isoindole-1,3(2H)-dione, with the CAS number 5394-18-3, is a chemical compound that features a unique structure characterized by an isoindole core substituted with a bromobutyl group. This compound typically exhibits properties associated with both aromatic and aliphatic systems due to its fused ring structure. The presence of the bromine atom introduces significant electronegativity, which can influence the compound's reactivity and solubility in various solvents. Isoindole derivatives are often studied for their potential biological activities, including anti-inflammatory and anticancer properties. The compound's molecular structure suggests it may participate in various chemical reactions, such as nucleophilic substitutions or electrophilic additions, depending on the conditions. Additionally, its physical properties, such as melting point and solubility, can vary based on the specific conditions and purity of the sample. Overall, 2-(4-Bromobutyl)-1H-isoindole-1,3(2H)-dione represents a class of compounds with potential applications in medicinal chemistry and materials science.
Formula:C12H12BrNO2
InChI:InChI=1S/C12H12BrNO2/c13-7-3-4-8-14-11(15)9-5-1-2-6-10(9)12(14)16/h1-2,5-6H,3-4,7-8H2
InChI key:InChIKey=UXFWTIGUWHJKDD-UHFFFAOYSA-N
SMILES:O=C1C=2C(C(=O)N1CCCCBr)=CC=CC2
Synonyms:- 1-Phthalimido-4-bromobutane
- 1H-Isoindole-1,3(2H)-dione, 2-(4-bromobutyl)-
- 2-(4-Bromobutyl)-1H-isoindole-1,3(2H)-dione
- 2-(4-Bromobutyl)-2,3-dihydro-1H-isoindole-1,3-dione
- 2-(4-Bromobutyl)isoindole-1,3-dione
- 2-(4-Bromobutyl)isoindoline-1,3-dione
- 2-(4-Bromobutyl)phthalimide
- 4-Bromobutylphthalimide
- N-Cyano-N-methyl-3-(4-trifluoromethyl phenoxy)-3-phenyl propanamine
- NSC 575
- Phthalimide, N-(4-bromobutyl)-
- N-(4-Bromobutyl)phthalimide
- N-(4-Brompobutyl)phthalimide
- AKOS 92204
- N-(omega-Bromobutyl)phthalimide
- 2-(4-Bromobutyl)-2H-isoindole-1,3-dione
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 9 products.
N-(4-Bromobutyl)phthalimide
CAS:Formula:C12H12BrNO2Purity:>98.0%(N)Color and Shape:White to Light yellow powder to crystalMolecular weight:282.14N-(4-Bromobutyl)phthalimide, 96%
CAS:N-(4-Bromobutyl)phthalimide is used in organic synthesis and the production of pharmaceutical. It can react with 1-phenyl-piperazine to get N-[4-(4-phenyl-piperazin-1-yl)-butyl]-phthalimide. It is a useful synthesis reagent used to synthesize B-cyclodextrin derivatives. This Thermo Scientific ChemicFormula:C12H12BrNO2Purity:96%Color and Shape:White to cream, PowderMolecular weight:282.142-(4-Bromobutyl)isoindoline-1,3-dione
CAS:Formula:C12H12BrNO2Purity:95%Color and Shape:SolidMolecular weight:282.1332Ref: IN-DA003SBU
5kgTo inquire10kgTo inquire25kgTo inquire5g25.00€10g29.00€25g41.00€100g97.00€500g266.00€N-(4-Bromobutyl)phthalimide
CAS:Formula:C12H12BrNO2Purity:98.0%Color and Shape:SolidMolecular weight:282.137N-(4-Bromobut-1-yl)phthalimide
CAS:N-(4-Bromobut-1-yl)phthalimide
Formula:C12H12BrNO2Purity:98%Color and Shape: white solidMolecular weight:282.13318g/molN-(4-Bromobutyl)phthalimide
CAS:Controlled ProductApplications N-(4-Bromobutyl)phthalimide is used in the preparation of β-cyclodextrin derivatives that block the pore formed by protective antigen for the inhibition of the action of anthrax toxin.
References Karginov, V.A., et. al.: Bioorg. Med. Chem., 14, 33 (2006)Formula:C12H12BrNO2Color and Shape:NeatMolecular weight:282.13N-(4-Bromobutyl)phthalimide
CAS:N-(4-Bromobutyl)phthalimide is a chemical compound that can be used to make dopamine D3. It is an alkylation agent and has been shown to be effective in the conjugation of albumin with monoclonal antibodies. N-(4-Bromobutyl)phthalimide is activated by carboxy, vinyl alcohol, and octamer and reacts with primary amino groups in dopamine. The dilution method is used to determine the concentration of dopamine D3 in a solution. This product can also be used as a chemical intermediate for other pharmaceuticals.Formula:C12H12BrNO2Purity:(%) Min. 95%Color and Shape:PowderMolecular weight:282.13 g/mol








