CAS 5394-37-6

5-phenyl-5-propylimidazolidine-2,4-dione

Description:

5-Phenyl-5-propylimidazolidine-2,4-dione, also known by its CAS number 5394-37-6, is a chemical compound characterized by its imidazolidine core structure, which features a five-membered ring containing two nitrogen atoms. This compound exhibits a dione functional group, indicating the presence of two carbonyl (C=O) groups, contributing to its reactivity and potential applications in organic synthesis. The phenyl and propyl substituents enhance its hydrophobic character, influencing its solubility and interaction with biological systems. Typically, compounds of this class may exhibit biological activity, making them of interest in medicinal chemistry. The presence of the imidazolidine ring suggests potential for tautomerism and various reaction pathways, including nucleophilic attacks and cyclization reactions. Additionally, the compound's stability and reactivity can be influenced by the electronic effects of the substituents, which may affect its pharmacological properties. Overall, 5-phenyl-5-propylimidazolidine-2,4-dione represents a versatile structure in organic chemistry with potential applications in drug development and material science.

Formula: C₁₂H₁₄N₂O₂

InChI: InChI=1/C12H14N2O2/c1-2-8-12(9-6-4-3-5-7-9)10(15)13-11(16)14-12/h3-7H,2,8H2,1H3,(H2,13,14,15,16)

SMILES: CCCC1(c2ccccc2)C(=NC(=N1)O)O

Synonyms:

• 2,4-Imidazolidinedione, 5-Phenyl-5-Propyl-

5-Phenyl-5-propylimidazolidine-2,4-dione

CAS: 5394-37-6

Versatile small molecule scaffold

Formula: C₁₂H₁₄N₂O₂

Purity: Min. 95%

Molecular weight: 218.25 g/mol

Ref: 3D-FAA39437