CAS 5394-50-3
:1,2-Bis(phenylmethyl) 1,2-hydrazinedicarboxylate
Description:
1,2-Bis(phenylmethyl) 1,2-hydrazinedicarboxylate, with the CAS number 5394-50-3, is an organic compound characterized by its hydrazine and carboxylate functional groups. This compound features two phenylmethyl groups attached to a hydrazine backbone, which contributes to its unique reactivity and potential applications in organic synthesis. The presence of carboxylate groups indicates that it can participate in various chemical reactions, including esterification and amidation. Typically, such compounds exhibit moderate solubility in organic solvents, while their stability can be influenced by environmental factors such as temperature and pH. The hydrazine moiety is known for its ability to form coordination complexes with metals, making this compound of interest in coordination chemistry. Additionally, derivatives of hydrazine compounds are often explored for their biological activities, including potential anti-cancer properties. However, handling such compounds requires caution due to the toxicity associated with hydrazines. Overall, 1,2-Bis(phenylmethyl) 1,2-hydrazinedicarboxylate serves as a versatile building block in synthetic organic chemistry.
Formula:C16H16N2O4
InChI:InChI=1/C16H16N2O4/c19-15(21-11-13-7-3-1-4-8-13)17-18-16(20)22-12-14-9-5-2-6-10-14/h1-10H,11-12H2,(H,17,19)(H,18,20)
InChI key:InChIKey=UEYMRBONTZTXQP-UHFFFAOYSA-N
SMILES:C(OC(NNC(OCC1=CC=CC=C1)=O)=O)C2=CC=CC=C2
Synonyms:- 1,2-Bis(phenylmethyl) 1,2-hydrazinedicarboxylate
- 1,2-Hydrazinedicarboxylic Acid, Bis(Phenylmethyl) Ester
- 1,2-Hydrazinedicarboxylic acid, 1,2-bis(phenylmethyl) ester
- Bicarbamic acid, dibenzyl ester
- Dibenzyl 1,2-hydrazinedicarboxylate
- Dibenzyl hydrazodicarboxylate
- N,N′-Bis(benzyloxycarbonyl)hydrazine
- NSC 3457
- N′-(Benzyloxycarbonyl)hydrazinecarboxylic acid benzyl ester
- Dibenzyl hydrazine-1,2-dicarboxylate
- 1,2-Hydrazinedicarboxylicacid, 1,2-bis(phenylmethyl) ester
- Linezolid Impurity 52
- Linezolid Impurity S
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
1,2-DICARBOBENZYLOXYHYDRAZINE
CAS:Formula:C16H16N2O4Purity:95%Color and Shape:SolidMolecular weight:300.3092Dibenzyl hydrazine-1,2-dicarboxylate
CAS:Dibenzyl hydrazine-1,2-dicarboxylatePurity:99%Molecular weight:300.31g/molDIBENZYL HYDRAZODICARBOXYLATE
CAS:Formula:C16H16N2O4Purity:95%Color and Shape:Solid, No data available.Molecular weight:300.314Dibenzyl hydrazine-1,2-dicarboxylate
CAS:Dibenzyl hydrazine-1,2-dicarboxylate is a tert-butyl compound with a tetrahydro substituent. It can be synthesized by the reaction of benzyl alcohol with sodium halide in an alcohol solvent. The yields are dependent on the type of halide used. Dibenzyl hydrazine-1,2-dicarboxylate can be prepared as a sodium salt or a potassium salt. The potassium salt is preferred because it is less toxic than the sodium salt and has better solubility in water. Dibenzyl hydrazine-1,2-dicarboxylate forms dihydro derivatives when reacted with amines or benzene. Dihydro derivatives of dibenzyl hydrazine-1,2-dicarboxylate have been shown to be effective as anticonvulsants and antipsychotics due to their ability to block dopamine receptors
Formula:C16H16N2O4Purity:Min. 95%Color and Shape:PowderMolecular weight:300.31 g/mol




