CAS 53944-40-4

7-acetyl-5H-chromeno[2,3-b]pyridin-5-one

Description:

7-Acetyl-5H-chromeno[2,3-b]pyridin-5-one is a heterocyclic organic compound characterized by its fused chromone and pyridine structures. This compound features a chromone backbone, which is a benzopyran derivative, and a pyridine ring, contributing to its unique chemical properties. It typically exhibits a yellow to brown color and is soluble in organic solvents, reflecting its aromatic nature. The presence of the acetyl group enhances its reactivity, making it a potential candidate for various chemical reactions, including acylation and condensation. This compound may also display biological activity, as many derivatives of chromones and pyridines are known for their pharmacological properties, including anti-inflammatory and antimicrobial effects. Its molecular structure allows for potential interactions with biological targets, making it of interest in medicinal chemistry. Additionally, the compound's stability and reactivity can be influenced by factors such as pH and solvent polarity, which are important considerations in its application in research and industry.

Formula: C₁₄H₉NO₃

InChI: InChI=1/C14H9NO3/c1-8(16)9-4-5-12-11(7-9)13(17)10-3-2-6-15-14(10)18-12/h2-7H,1H3

SMILES: CC(=O)c1ccc2c(c1)c(=O)c1cccnc1o2

Pranoprofen Impurity 33

CAS: 53944-40-4

Formula: C₁₄H₉NO₃

Molecular weight: 239.23

Ref: 4Z-P-110036

7-Acetyl-5-oxo-5H-[1]benzopyrano[2,3-b]pyridine

Controlled Product

CAS: 53944-40-4

Applications 7-Acetyl-5-oxo-5H-[1]benzopyrano[2,3-b]pyridine has the potential to show antihistiminic and anaphylactic compounds. Maintains potential anti-inflammatory compounds.
References Tozzi, S. et al.: J. Med. Chem., 18, 1 (1975);

Formula: C₁₄H₉NO₃

Color and Shape: Neat

Molecular weight: 239.23

Ref: TR-A187870

Y 9000

CAS: 53944-40-4

Y 9000 has anti-allergic activity.

Formula: C₁₄H₉NO₃

Purity: 98%

Color and Shape: Solid

Molecular weight: 239.23

Ref: TM-T26341