CAS 53947-86-7

Euparone

Description:

Euparone, with the CAS number 53947-86-7, is a chemical compound known for its role as a synthetic organic compound. It is characterized by its unique structure, which includes a bicyclic framework that contributes to its biological activity. Euparone is primarily recognized for its potential applications in medicinal chemistry, particularly due to its anti-inflammatory and analgesic properties. The compound exhibits moderate solubility in organic solvents, which can influence its bioavailability and efficacy in various formulations. Additionally, Euparone has been studied for its effects on cellular processes, making it of interest in pharmacological research. Its stability under standard conditions allows for its use in various experimental settings, although care must be taken regarding its handling and storage due to potential reactivity with certain agents. Overall, Euparone represents a valuable compound in the field of organic chemistry and pharmacology, with ongoing research aimed at elucidating its full range of biological activities and potential therapeutic applications.

Formula: C₁₂H₁₀O₄

InChI: InChI=1S/C12H10O4/c1-6(13)9-3-8-4-11(7(2)14)16-12(8)5-10(9)15/h3-5,15H,1-2H3

InChI key: InChIKey=FOXRXAILTBHLQA-UHFFFAOYSA-N

SMILES: C(C)(=O)C=1OC=2C(=CC(C(C)=O)=C(O)C2)C1

Synonyms:

• 1,1′-(6-Hydroxy-2,5-benzofurandiyl)bis[ethanone]
• 1-(5-Acetyl-6-hydroxy-1-benzofuran-2-yl)ethan-1-one
• 2,5-Diacetyl-6-hydroxybenzofuran
• Ethanone, 1,1'-(6-hydroxy-2,5-benzofurandiyl)bis-
• Euparone

Euparone

CAS: 53947-86-7

Euparone is a benzofuran from Ruscus aculeatus L..

Formula: C₁₂H₁₀O₄

Purity: 98%

Color and Shape: Solid

Molecular weight: 218.21

Ref: TM-TN4036

Euparone

CAS: 53947-86-7

Formula: C₁₂H₁₀O₄

Purity: 95%~99%

Molecular weight: 218.208

Ref: BP-SBP04178

Euparone

CAS: 53947-86-7

Euparone is a naturally derived chemical compound, which is a chalcone sourced from various plant species. It features an open-chain flavonoid structure, commonly found in plants known for their diverse biological activities. The mode of action of Euparone involves the inhibition of specific enzymes and pathways, which may influence cellular processes such as apoptosis, inflammation, and oxidation. This characteristic suggests a potential for modulating biochemical pathways relevant to health and disease.

Formula: C₁₂H₁₀O₄

Purity: Min. 95%

Molecular weight: 218.2 g/mol

Ref: 3D-DCA94786