CAS 53947-92-5
:3-(2,2-Dimethyl-2H-1-benzopyran-6-yl)-7-hydroxy-4H-1-benzopyran-4-one
Description:
The chemical substance known as "3-(2,2-Dimethyl-2H-1-benzopyran-6-yl)-7-hydroxy-4H-1-benzopyran-4-one," with the CAS number 53947-92-5, is a flavonoid derivative characterized by its complex polycyclic structure. This compound features two benzopyran moieties, which contribute to its potential biological activity, including antioxidant properties. The presence of hydroxyl groups enhances its reactivity and solubility in polar solvents, making it of interest in various biochemical applications. Its unique structure may also influence its interaction with biological targets, suggesting potential therapeutic uses. Additionally, the dimethyl substitution on the benzopyran ring can affect its stability and lipophilicity. Overall, this compound exemplifies the diverse chemistry of flavonoids, which are known for their roles in plant pigmentation and human health benefits. Further studies may explore its pharmacological properties and applications in medicinal chemistry.
Formula:C20H16O4
InChI:InChI=1S/C20H16O4/c1-20(2)8-7-13-9-12(3-6-17(13)24-20)16-11-23-18-10-14(21)4-5-15(18)19(16)22/h3-11,21H,1-2H3
InChI key:InChIKey=PWAACAMQKVIVPZ-UHFFFAOYSA-N
SMILES:O=C1C(=COC=2C1=CC=C(O)C2)C=3C=C4C(=CC3)OC(C)(C)C=C4
Synonyms:- 3-(2,2-Dimethyl-2H-1-benzopyran-6-yl)-7-hydroxy-4H-1-benzopyran-4-one
- 4H-1-Benzopyran-4-one, 3-(2,2-dimethyl-2H-1-benzopyran-6-yl)-7-hydroxy-
- 7-hydroxy-2',2'-dimethyl-2'H,4H-3,6'-bichromen-4-one
- Corylin
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 8 products.
Ref: IN-DA00DB8A
1gTo inquire1mg51.00€5mg57.00€10mg67.00€25mg108.00€50mg128.00€100mg190.00€250mg337.00€Corylin
CAS:Corylin is a major bioactive compound isolated from Psoralea corylifolia L; it has the activity of antibiotic or anticancer.Formula:C20H16O4Purity:98.44% - >99.99%Color and Shape:SolidMolecular weight:320.34Ref: TM-T6S0141
5mg44.00€10mg55.00€1mL*10mM (DMSO)66.00€25mg86.00€50mg111.00€100mg160.00€200mg227.00€Corylin
CAS:Oxygen-heterocyclic compoundFormula:C20H16O4Purity:≥ 95.0 % (HPLC)Color and Shape:PowderMolecular weight:320.35Corylin
CAS:Corylin is a natural compound, classified as a bioactive prenylated flavonoid, which is isolated from the seeds of the plant Psoralea corylifolia, commonly known in traditional medicine for its diverse therapeutic properties. This compound exhibits a multifaceted mode of action, primarily through the modulation of various cellular signaling pathways, including the inhibition of inflammatory mediators and the regulation of cell cycle processes. Its ability to interfere with these biological pathways underpins its potential therapeutic applications.
Purity:Min. 95%Ref: 3D-FC74195
Discontinued product






