CAS 5395-47-1

2-methoxy-4-[(1Z)-2-nitroprop-1-en-1-yl]phenol

Description:

2-Methoxy-4-[(1Z)-2-nitroprop-1-en-1-yl]phenol, with the CAS number 5395-47-1, is an organic compound characterized by its phenolic structure, which includes a methoxy group and a nitro-substituted alkenyl group. This compound typically exhibits properties associated with both phenols and nitro compounds, such as potential antioxidant activity and reactivity due to the presence of the nitro group. The methoxy group enhances its solubility in organic solvents and may influence its biological activity. The compound's structure suggests it could participate in various chemical reactions, including electrophilic substitutions and reductions. Additionally, due to the presence of the nitro group, it may exhibit specific interactions with biological systems, making it of interest in medicinal chemistry and materials science. Its stability, reactivity, and potential applications would depend on the specific conditions under which it is used, including pH, temperature, and the presence of other reactive species.

Formula: C₁₀H₁₁NO₄

InChI: InChI=1/C10H11NO4/c1-7(11(13)14)5-8-3-4-9(12)10(6-8)15-2/h3-6,12H,1-2H3/b7-5-

SMILES: C/C(=C/c1ccc(c(c1)OC)O)/N(=O)=O

Synonyms:

• phenol, 2-methoxy-4-[(1Z)-2-nitro-1-propen-1-yl]-

1-(4-Hydroxy-3-methoxyphenyl)-2-nitropropene

CAS: 5395-47-1

1-(4-Hydroxy-3-methoxyphenyl)-2-nitropropene is a versatile building block that can be used to synthesize a wide variety of complex compounds. The compound is known for its use in the synthesis of research chemicals, reagents, and speciality chemicals. 1-(4-Hydroxy-3-methoxyphenyl)-2-nitropropene is also useful as a building block for the synthesis of high quality and useful intermediates. It may also be used as a reaction component or scaffold for the synthesis of biologically active compounds.

Formula: C₁₀H₁₁NO₄

Purity: Min. 95%

Color and Shape: Powder

Molecular weight: 209.2 g/mol

Ref: 3D-FH68037

2-Methoxy-4-(2-nitro-1-propenyl)phenol

Controlled Product

CAS: 5395-47-1

Applications A nitrostyrene derivative with potential antibacterial properties against gram positive bacteria such as Staphylococcus aureus, Enterococcus faecalis, and Enterococcus faecium.
References Milhazes, N., et al.: Chem. Res. Toxicol., 19, 1294 (2006), Milhazes, N., et al.: Bioorg. Med. Chem., 14, 4078 (2006),

Formula: C₁₀H₁₁NO₄

Color and Shape: Neat

Molecular weight: 209.2

Ref: TR-M265000