CAS 5396-30-5: 9-Chloro-1,2,3,4-tetrahydroacridine
Description:9-Chloro-1,2,3,4-tetrahydroacridine is a chemical compound characterized by its bicyclic structure, which includes a chloro substituent at the 9-position of the acridine framework. This compound typically appears as a solid at room temperature and is soluble in organic solvents. It exhibits properties associated with both aromatic and aliphatic compounds due to its fused ring system. The presence of the chlorine atom can influence its reactivity, making it a potential candidate for various chemical reactions, including nucleophilic substitutions. 9-Chloro-1,2,3,4-tetrahydroacridine has been studied for its biological activities, including potential applications in medicinal chemistry, particularly in the development of drugs targeting neurological disorders. Its structural features may contribute to its ability to interact with biological targets, although specific biological activity can vary based on the context of use. As with many chemical substances, safety precautions should be observed when handling this compound, as it may pose health risks if not managed properly.
Formula:C13H12ClN
InChI:InChI=1S/C13H12ClN/c14-13-9-5-1-3-7-11(9)15-12-8-4-2-6-10(12)13/h1,3,5,7H,2,4,6,8H2
InChI key:InChIKey=IYPJWKLHPNECFJ-UHFFFAOYSA-N
SMILES:ClC=1C=2C=CC=CC2N=C3C1CCCC3
- Synonyms:
- Acridine, 9-Chloro-1,2,3,4-Tetrahydro-
- NSC 1235
- 9-CHLORO-1,2,3,4-TETRAHYDROACRIDINE
- 9-Chloro-1,2,3,4-tetrahydroacridine
