CAS 53960-10-4
:methyl 4-oxo-3,4-dihydrophthalazine-1-carboxylate
Description:
Methyl 4-oxo-3,4-dihydrophthalazine-1-carboxylate, identified by its CAS number 53960-10-4, is a chemical compound that belongs to the class of phthalazine derivatives. It features a phthalazine core structure, which is characterized by a fused bicyclic system containing two nitrogen atoms. This compound typically exhibits a carbonyl group (C=O) and a carboxylate ester functional group, contributing to its reactivity and potential applications in organic synthesis. Methyl 4-oxo-3,4-dihydrophthalazine-1-carboxylate is often studied for its biological activities, including potential pharmaceutical applications, due to its ability to interact with various biological targets. The presence of the methyl ester group enhances its solubility in organic solvents, making it suitable for various chemical reactions. Additionally, the compound may exhibit specific physical properties such as melting point and solubility characteristics that are important for its handling and application in research and industry. Overall, this compound represents a valuable structure in medicinal chemistry and synthetic organic chemistry.
Formula:C10H8N2O3
InChI:InChI=1/C10H8N2O3/c1-15-10(14)8-6-4-2-3-5-7(6)9(13)12-11-8/h2-5H,1H3,(H,12,13)
SMILES:COC(=O)c1c2ccccc2c(nn1)O
Synonyms:- 1-Phthalazinecarboxylic Acid, 3,4-Dihydro-4-Oxo-, Methyl Ester
- 4-Oxo-3,4-dihydro-phthalazine-1-carboxylic acid methyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
