CAS 5397-78-4

2-Acetamido-3-chloro-1,4-naphthoquinone

Description:

2-Acetamido-3-chloro-1,4-naphthoquinone is a synthetic organic compound characterized by its naphthoquinone structure, which features a quinone moiety fused to a naphthalene ring. This compound contains an acetamido group and a chlorine substituent, contributing to its unique chemical properties. It typically appears as a solid and is known for its potential biological activity, including antimicrobial and anticancer properties. The presence of the chloro group enhances its reactivity, making it useful in various chemical reactions. The compound is soluble in organic solvents, and its stability can be influenced by environmental factors such as light and temperature. As with many naphthoquinones, it may exhibit redox behavior, allowing it to participate in electron transfer processes. Safety precautions should be taken when handling this compound, as it may pose health risks, including skin and respiratory irritation. Overall, 2-Acetamido-3-chloro-1,4-naphthoquinone is of interest in both synthetic organic chemistry and medicinal chemistry research.

Formula: C₁₂H₈ClNO₃

InChI: InChI=1S/C12H8ClNO3/c1-6(15)14-10-9(13)11(16)7-4-2-3-5-8(7)12(10)17/h2-5H,1H3,(H,14,15)

InChI key: InChIKey=OMXMYDUYAUOFRX-UHFFFAOYSA-N

SMILES: O=C1C=2C(C(=O)C(Cl)=C1NC(C)=O)=CC=CC2

Synonyms:

• Acetamide, N-(3-chloro-1,4-dihydro-1,4-dioxo-2-naphthalenyl)-
• N-(3-Chloro-1,4-dihydro-1,4-dioxo-2-naphthalenyl)acetamide
• 2-Chloro-3-acetamidonaphthoquinone
• 1,4-Naphthoquinone, 2-acetamido-3-chloro-
• Acetamide, N-(3-chloro-1,4-dihydro-1,4-dioxo-2-naphthyl)-

PNU-37802

CAS: 5397-78-4

Formula: C₁₂H₈ClNO₃

Purity: 95%

Molecular weight: 249.6498

Ref: IN-DA00E8JP

NP-313

CAS: 5397-78-4

NP-313

Purity: ≥98%

Molecular weight: 249.65g/mol

Ref: 54-BUP02736

2-Acetylamino-3-chloro-1,4-naphthoquinone

CAS: 5397-78-4

2-Acetylamino-3-chloro-1,4-naphthoquinone is a medicinal compound that has shown promising anticancer properties. It acts as an inhibitor of protein kinases, which are enzymes that regulate cellular processes such as cell growth and division. This compound has been found to induce apoptosis (programmed cell death) in various cancer cell lines, including those derived from human and Chinese hamster tumors. 2-Acetylamino-3-chloro-1,4-naphthoquinone is an analog of vitamin K and is excreted in urine after administration. Its potential as a therapeutic agent for cancer treatment is currently being studied.

Formula: C₁₂H₈ClNO₃

Purity: Min. 95%

Molecular weight: 249.65 g/mol

Ref: 3D-FAA39778

NP-313

CAS: 5397-78-4

NP-313 (NSC-4264) is a potent antithrombotic that blocks platelet aggregation via thromboxane A2 synthesis inhibition and targets SOCC-mediated Ca2+ efflux.

Formula: C₁₂H₈ClNO₃

Purity: 99.92%

Color and Shape: Solid

Molecular weight: 249.65

Ref: TM-T24542