CymitQuimica logo

CAS 5398-24-3

:

2-bromobutanamide

Description:
2-Bromobutanamide is an organic compound characterized by the presence of a bromine atom and an amide functional group attached to a butane backbone. Its molecular structure consists of a four-carbon chain (butane) with a bromine substituent at the second carbon and an amide group (-C(=O)NH2) at the terminal carbon. This compound is typically a colorless to pale yellow liquid or solid, depending on its purity and temperature. It is soluble in polar solvents like water and alcohols due to the presence of the amide group, which can engage in hydrogen bonding. 2-Bromobutanamide can be synthesized through various methods, including the bromination of butanamide or related precursors. It is of interest in organic synthesis and medicinal chemistry, as it may serve as an intermediate in the preparation of pharmaceuticals or other biologically active compounds. As with many brominated compounds, it may exhibit specific reactivity patterns, including nucleophilic substitution reactions, making it a valuable building block in synthetic organic chemistry.
Formula:C4H8BrNO
InChI:InChI=1/C4H8BrNO/c1-2-3(5)4(6)7/h3H,2H2,1H3,(H2,6,7)
InChI key:AKSLRYGHJVUELA-UHFFFAOYSA-N
SMILES:CCC(C(=N)O)Br
Found 4 products.