CAS 5398-69-6

2-iodo-3-nitrobenzoic acid

Description:

2-Iodo-3-nitrobenzoic acid is an organic compound characterized by the presence of both an iodine atom and a nitro group attached to a benzoic acid structure. Its molecular formula is C7H4I NO4, indicating that it contains seven carbon atoms, four hydrogen atoms, one iodine atom, one nitrogen atom, and four oxygen atoms. The compound features a carboxylic acid functional group (-COOH), which contributes to its acidic properties. The iodine substituent at the second position and the nitro group at the third position on the benzene ring influence its reactivity and polarity, making it useful in various chemical syntheses and applications, including pharmaceuticals and agrochemicals. The presence of the nitro group also enhances the compound's electrophilic character, which can facilitate further chemical reactions. Additionally, 2-iodo-3-nitrobenzoic acid is typically a solid at room temperature and may exhibit moderate solubility in polar solvents. Safety precautions should be taken when handling this compound due to its potential toxicity and environmental impact.

Formula: C₇H₄INO₄

InChI: InChI=1/C7H4INO4/c8-6-4(7(10)11)2-1-3-5(6)9(12)13/h1-3H,(H,10,11)

SMILES: c1cc(c(c(c1)N(=O)=O)I)C(=O)O

Synonyms:

• Benzoic acid, 2-iodo-3-nitro-
• 2-Iodo-3-nitrobenzoic acid

Benzoic acid, 2-​iodo-​3-​nitro-

CAS: 5398-69-6

Formula: C₇H₄INO₄

Purity: 95%

Color and Shape: Solid

Molecular weight: 293.0154

Ref: IN-DA003HGI

2-Iodo-3-nitrobenzoic acid

CAS: 5398-69-6

2-Iodo-3-nitrobenzoic acid

Formula: C₇H₄INO₄

Purity: ≥95%

Color and Shape: light yellow solid

Molecular weight: 293.02g/mol

Ref: 54-OR27519

2-Iodo-3-nitro-benzoic acid

CAS: 5398-69-6

Formula: C₇H₄INO₄

Purity: 95%

Color and Shape: Solid

Molecular weight: 293.016

Ref: 10-F029190