CAS 53981-69-4

1-(1H-imidazol-2-yl)ethanone

Description:

1-(1H-imidazol-2-yl)ethanone, with the CAS number 53981-69-4, is an organic compound characterized by its imidazole ring structure, which is a five-membered heterocyclic compound containing two nitrogen atoms. This substance features a ketone functional group attached to an ethyl chain, making it a derivative of imidazole. It is typically a white to off-white solid at room temperature and is soluble in polar solvents such as water and alcohols, owing to the presence of the imidazole moiety. The compound exhibits biological activity, often studied for its potential applications in pharmaceuticals and as a building block in organic synthesis. Its reactivity is influenced by the electron-rich nature of the imidazole ring, allowing for various chemical transformations. Additionally, it may participate in hydrogen bonding due to the nitrogen atoms, which can affect its interactions in biological systems. Overall, 1-(1H-imidazol-2-yl)ethanone is a versatile compound with significant implications in medicinal chemistry and material science.

Formula: C₅H₆N₂O

InChI: InChI=1/C5H6N2O/c1-4(8)5-6-2-3-7-5/h2-3H,1H3,(H,6,7)

SMILES: CC(=O)c1[nH]ccn1

Synonyms:

• Ethanone, 1-(1H-imidazol-2-yl)-

1-(1H-Imidazol-2-yl)ethanone

CAS: 53981-69-4

Formula: C₅H₆N₂O

Purity: 97%

Color and Shape: Solid

Molecular weight: 110.1139

Ref: IN-DA00D95Y

2-Acetylimidazole

CAS: 53981-69-4

2-Acetylimidazole

Purity: 97%

Color and Shape: Pale Yellow To Brown Solid

Molecular weight: 110.11g/mol

Ref: 54-OR313011

1-(1H-Imidazol-2-yl)ethanone

Controlled Product

CAS: 53981-69-4

Formula: C₅H₆N₂O

Color and Shape: Off-White

Molecular weight: 110.114

Ref: TR-I577558

2-Acetylimidazole

CAS: 53981-69-4

Formula: C₅H₆N₂O

Purity: 97%

Color and Shape: Oil

Molecular weight: 110.116

Ref: 10-F036617