CAS 53985-75-4

7-(trifluoromethoxy)quinolin-4-ol

Description:

7-(Trifluoromethoxy)quinolin-4-ol is a chemical compound characterized by its quinoline structure, which is a bicyclic aromatic compound containing a nitrogen atom. The presence of the trifluoromethoxy group (-OCF3) at the 7-position significantly influences its chemical properties, enhancing its lipophilicity and potentially its biological activity. This compound typically exhibits a solid-state form and may be used in various applications, including medicinal chemistry, due to its potential as a pharmacophore. The hydroxyl group (-OH) at the 4-position contributes to its ability to form hydrogen bonds, which can affect its solubility and reactivity. Additionally, the trifluoromethoxy substituent can impart unique electronic properties, making it a subject of interest in the development of novel therapeutic agents. Overall, 7-(trifluoromethoxy)quinolin-4-ol is notable for its structural features that may confer specific biological activities and its utility in synthetic organic chemistry.

Formula: C₁₀H₆F₃NO₂

InChI: InChI=1/C10H6F3NO2/c11-10(12,13)16-6-1-2-7-8(5-6)14-4-3-9(7)15/h1-5H,(H,14,15)

SMILES: c1cc2c(cc1OC(F)(F)F)[nH]ccc2=O

Synonyms:

• 4-Quinolinol, 7-(Trifluoromethoxy)-
• 7-(Trifluoromethoxy)quinolin-4-ol

4-Hydroxy-7-trifluoromethoxyquinoline

CAS: 53985-75-4

Formula: C₁₀H₆F₃NO₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 229.1553

Ref: IN-DA00DBNM

7-(Trifluoromethoxy)-4-hydroxyquinoline

CAS: 53985-75-4

7-(Trifluoromethoxy)-4-hydroxyquinoline

Purity: ≥95%

Molecular weight: 229.16g/mol

Ref: 54-PC905518

7-(Trifluoromethoxy)quinolin-4-ol

CAS: 53985-75-4

Formula: C₁₀H₆F₃NO₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 229.158

Ref: 10-F239359