CAS 5399-95-1
:7-chloro-3-methyl-2H-pyrazolo[4,3-d]pyrimidine
Description:
7-Chloro-3-methyl-2H-pyrazolo[4,3-d]pyrimidine is a heterocyclic compound characterized by its fused pyrazole and pyrimidine rings, which contribute to its unique chemical properties. The presence of a chlorine atom at the 7-position and a methyl group at the 3-position enhances its reactivity and solubility in various organic solvents. This compound typically exhibits a pale yellow to off-white crystalline appearance. It is known for its potential biological activity, particularly in medicinal chemistry, where it may serve as a scaffold for developing pharmaceuticals, especially in the context of targeting specific enzymes or receptors. The compound's structure allows for various substitution patterns, which can influence its pharmacological properties. Additionally, it may exhibit moderate to high stability under standard laboratory conditions, although it should be handled with care due to the presence of chlorine, which can impart toxicity. Overall, 7-chloro-3-methyl-2H-pyrazolo[4,3-d]pyrimidine is of interest in both synthetic and medicinal chemistry fields.
Formula:C6H5ClN4
InChI:InChI=1/C6H5ClN4/c1-3-4-5(11-10-3)6(7)9-2-8-4/h2H,1H3,(H,10,11)
SMILES:Cc1c2c(c(Cl)ncn2)n[nH]1
Synonyms:- 1H-pyrazolo[4,3-d]pyrimidine, 7-chloro-3-methyl-
- 7-Chloro-3-methyl-1H-pyrazolo[4,3-d]pyrimidine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
7-Chloro-3-methyl-1H-pyrazolo[4,3-d]pyrimidine
CAS:Formula:C6H5ClN4Purity:95.0%Molecular weight:168.587-Chloro-3-methyl-1H-pyrazolo[4,3-d]pyrimidine
CAS:Formycin is a form of potassium glycolate (KG), which belongs to the class of chlorinated alkyl ethers. Formycin has been used as an antiseptic, but is no longer in use due to its toxicity. It is also a potent inhibitor of bacterial growth and was used in the past for treating tuberculosis. The methylation of KG produces formaldehyde, which can react with ethylene glycol to produce ethylene glycol monomethyl ether (EGME). EGME is highly toxic and can cause lung damage.Formula:C6H5ClN4Purity:Min. 95%Molecular weight:168.58 g/mol


