CAS 540-12-5
:Ricinelaidic acid
Description:
Ricinelaidic acid, with the CAS number 540-12-5, is a fatty acid that is classified as a trans isomer of ricinoleic acid. It is derived from castor oil and is characterized by its long hydrocarbon chain, which typically contains 18 carbon atoms and a double bond in the trans configuration. This structural feature influences its physical properties, making it more stable and less prone to oxidation compared to its cis counterpart. Ricinelaidic acid is typically a colorless to pale yellow liquid at room temperature and is insoluble in water but soluble in organic solvents. It has applications in various industries, including cosmetics, lubricants, and as an emulsifying agent in food products. Additionally, due to its unique properties, it is studied for potential uses in pharmaceuticals and as a surfactant. However, like many fatty acids, it should be handled with care, as it can cause irritation upon contact with skin or mucous membranes.
Formula:C18H34O3
InChI:InChI=1S/C18H34O3/c1-2-3-4-11-14-17(19)15-12-9-7-5-6-8-10-13-16-18(20)21/h9,12,17,19H,2-8,10-11,13-16H2,1H3,(H,20,21)/b12-9+/t17-/m1/s1
InChI key:InChIKey=WBHHMMIMDMUBKC-XLNAKTSKSA-N
SMILES:[C@H](C/C=C/CCCCCCCC(O)=O)(CCCCCC)O
Synonyms:- 9-Octadecenoic acid, 12-hydroxy-, (9E,12R)-
- 12-D-Hydroxy-9-trans-octadecenoic acid
- (9E,12R)-12-Hydroxy-9-octadecenoic acid
- Ricinelaidic acid
- 9-Octadecenoic acid, 12-hydroxy-, [R-(E)]-
- 9-trans-12-Hydroxyoctadecenoic acid
- (12R,9E)-12-Hydroxy-9-octadecenoic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
Ricinelaidic acid
CAS:Ricinelaidic acid is an unsaturated fatty acid that is a derivative of ricinoleic acid, primarily sourced from the hydrogenation of castor oil. This transformation alters the configuration of the double bond, positioning it in the trans configuration, which significantly influences its physical and chemical properties. Ricinelaidic acid acts by altering molecular interactions due to its unique structure, often impacting surface tension and viscosity in composite materials.Formula:C18H34O3Purity:Min. 95%Molecular weight:298.5 g/molRicinelaidic Acid
CAS:Ricinelaidic acid blocks LTB4 receptors; hampers human neutrophil responses; reduces rat bronchoconstriction by 46% at 1 mg/kg i.v.Formula:C18H34O3Color and Shape:SolidMolecular weight:298.46

