CAS 54008-77-4
:2-bromo-1-benzofuran
Description:
2-Bromo-1-benzofuran is an organic compound characterized by its fused benzene and furan rings, with a bromine atom substituted at the second position of the benzofuran structure. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its purity and form. It is known for its aromatic properties, which contribute to its stability and reactivity. The presence of the bromine atom enhances its electrophilic character, making it a useful intermediate in various organic synthesis reactions, including cross-coupling reactions and nucleophilic substitutions. 2-Bromo-1-benzofuran is also of interest in medicinal chemistry due to its potential biological activities, which may include antimicrobial or anti-inflammatory properties. However, handling this compound requires caution due to the toxicity associated with brominated compounds. As with many organic compounds, it is important to consider its solubility, boiling point, and reactivity with other chemicals when utilizing it in laboratory or industrial applications.
Formula:C8H5BrO
InChI:InChI=1/C8H5BrO/c9-8-5-6-3-1-2-4-7(6)10-8/h1-5H
SMILES:c1ccc2c(c1)cc(Br)o2
Synonyms:- 2-Bromobenzofuran
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
2-Bromobenzo[b]furan
CAS:2-Bromobenzo[b]furanPurity:98%Color and Shape:Yellow LiquidMolecular weight:197.0287g/mol2-Bromobenzofuran
CAS:2-Bromobenzofuran is a compound that has been shown to have antioxidant properties and can be used for the treatment of chronic kidney disease, hepatitis, and degenerative diseases. It has nitrogen atoms in its structure that are reactive with oxygen, which may cause the release of picolinic acid (PA), a compound that has been shown to have anti-inflammatory properties. 2-Bromobenzofuran is an alkynyl group that binds to receptors such as serotonin and dopamine. This group also has carbonyl groups, which can form adducts with amines. The piperazine ring in 2-bromobenzofuran is activated by reaction with hydroxyl groups.Formula:C8H5BrOPurity:Min. 95%Molecular weight:197.03 g/mol



