CAS 54014-05-0

[5-(3-methylphenyl)-1,3,4-oxadiazol-2-yl]methanol

Description:

[5-(3-methylphenyl)-1,3,4-oxadiazol-2-yl]methanol is a chemical compound characterized by its oxadiazole ring, which is a five-membered heterocyclic structure containing two nitrogen atoms and three carbon atoms. The presence of the 3-methylphenyl group indicates that there is a methyl substituent on the phenyl ring, contributing to the compound's hydrophobic characteristics. The methanol functional group (-CH2OH) suggests that the compound has potential for hydrogen bonding, which can influence its solubility and reactivity. This compound may exhibit biological activity due to the oxadiazole moiety, which is often associated with various pharmacological properties. Its molecular structure allows for potential interactions with biological targets, making it of interest in medicinal chemistry. Additionally, the compound's stability, melting point, and solubility would depend on the specific conditions and solvents used. Overall, [5-(3-methylphenyl)-1,3,4-oxadiazol-2-yl]methanol represents a unique structure that may have applications in drug development and materials science.

Formula: C₁₀H₁₀N₂O₂

InChI: InChI=1/C10H10N2O2/c1-7-3-2-4-8(5-7)10-12-11-9(6-13)14-10/h2-5,13H,6H2,1H3

SMILES: Cc1cccc(c1)c1nnc(CO)o1

[5-(3-Methylphenyl)-1,3,4-oxadiazol-2-yl]methanol

CAS: 54014-05-0

Versatile small molecule scaffold

Formula: C₁₀H₁₀N₂O₂

Purity: Min. 95%

Molecular weight: 190.2 g/mol

Ref: 3D-ECA01405