CymitQuimica logo

CAS 54015-04-2

:

(4-methylphenyl)-Guanidine

Description:
(4-Methylphenyl)guanidine, with the CAS number 54015-04-2, is an organic compound characterized by the presence of a guanidine functional group attached to a para-methylphenyl group. This compound typically appears as a white to off-white solid and is soluble in polar solvents such as water and alcohols, owing to the presence of the guanidine moiety, which can engage in hydrogen bonding. Its molecular structure features a central carbon atom bonded to two amino groups and one phenyl group, which contributes to its chemical reactivity and potential applications. (4-Methylphenyl)guanidine is often studied for its biological activity, including its role as a potential pharmacological agent. It may exhibit properties such as antimicrobial or anti-inflammatory effects, although specific biological activities can vary based on the context of use. Safety data should be consulted for handling and exposure, as with any chemical substance, to ensure proper laboratory practices.
Formula:C8H11N3
InChI:InChI=1S/C8H11N3/c1-6-2-4-7(5-3-6)11-8(9)10/h2-5H,1H3,(H4,9,10,11)
InChI key:PKQYVFHRKFDVCH-UHFFFAOYSA-N
SMILES:CC1=CC=C(C=C1)N=C(N)N
Found 4 products.