CAS 5402-37-9
:4-(2,3-dihydro-1H-inden-1-yl)phenol
Description:
4-(2,3-Dihydro-1H-inden-1-yl)phenol, with the CAS number 5402-37-9, is an organic compound characterized by its phenolic structure, which includes a hydroxyl group (-OH) attached to a phenyl ring. The compound features a bicyclic structure derived from indene, contributing to its unique chemical properties. It is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. The presence of the hydroxyl group suggests that it can participate in hydrogen bonding, influencing its reactivity and interactions with other molecules. This compound may be of interest in various fields, including organic synthesis and materials science, due to its potential applications in the development of polymers, antioxidants, or as intermediates in chemical reactions. Additionally, its structural features may impart specific biological activities, making it a candidate for further research in medicinal chemistry. As with many organic compounds, safety data should be consulted to understand its handling and potential hazards.
Formula:C15H14O
InChI:InChI=1/C15H14O/c16-13-8-5-12(6-9-13)15-10-7-11-3-1-2-4-14(11)15/h1-6,8-9,15-16H,7,10H2
SMILES:c1ccc2c(c1)CCC2c1ccc(cc1)O
Synonyms:- phenol, 4-(2,3-dihydro-1H-inden-1-yl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.