CAS 54023-01-7
:5-(3,4-dichlorophenyl)furan-2-carboxylic acid
Description:
5-(3,4-Dichlorophenyl)furan-2-carboxylic acid is an organic compound characterized by its furan ring structure substituted with a carboxylic acid group and a dichlorophenyl moiety. The presence of the furan ring contributes to its aromatic properties, while the carboxylic acid group imparts acidic characteristics, making it soluble in polar solvents. The dichlorophenyl substituent enhances the compound's lipophilicity and may influence its biological activity. This compound is often studied for its potential applications in pharmaceuticals and agrochemicals due to its unique structural features. Its molecular structure suggests it may exhibit interesting reactivity patterns, particularly in electrophilic aromatic substitution reactions. Additionally, the presence of chlorine atoms can affect the compound's electronic properties, potentially enhancing its reactivity or altering its interaction with biological targets. Overall, 5-(3,4-dichlorophenyl)furan-2-carboxylic acid is a compound of interest in various fields, including medicinal chemistry and materials science, due to its distinctive characteristics and potential applications.
Formula:C11H6Cl2O3
InChI:InChI=1/C11H6Cl2O3/c12-7-2-1-6(5-8(7)13)9-3-4-10(16-9)11(14)15/h1-5H,(H,14,15)
SMILES:c1cc(c(cc1c1ccc(C(=O)O)o1)Cl)Cl
Synonyms:- 2-Furancarboxylic acid, 5-(3,4-dichlorophenyl)-
- 5-(3,4-Dichlorophenyl)-2-furoic acid
- 5-(3 4-DICHLOROPHENYL)-2-FURONIC ACID
- 5-(3,4-Dichlorophenyl)-2-furoic acid 97%
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
5-(3,4-Dichlorophenyl)-2-furoic acid
CAS:Formula:C11H6Cl2O3Color and Shape:SolidMolecular weight:257.06955-(3,4-Dichlorophenyl)-2-furoic Acid
CAS:Controlled ProductApplications 5-(3,4-Dichlorophenyl)-2-furoic acid is a reactant in the preparation of dantrolene (D185000) which has a potential to treat vascular dysfunction.
References Ellis, K.O., et al.: J. Pharm. Sci., 69, 327 (1980); Harrison, G.G., et al.: Brit. J. Anaesth., 60, 279 (1988); Murasawa, S., et al.: Bioorg. Med. Chem., 20, 6384 (2012);Formula:C11H6Cl2O3Color and Shape:NeatMolecular weight:255.97

