CymitQuimica logo

CAS 54023-06-2

:

2-Furancarboxylic acid,5-(3-aminophenyl)-, methyl ester

Description:
2-Furancarboxylic acid, 5-(3-aminophenyl)-, methyl ester, also known by its CAS number 54023-06-2, is an organic compound characterized by the presence of a furan ring, a carboxylic acid functional group, and an amine substituent. This compound typically exhibits a polar nature due to the carboxylic acid and amine functionalities, which can engage in hydrogen bonding, influencing its solubility in polar solvents like water and alcohols. The methyl ester group contributes to its reactivity, making it a potential candidate for various chemical reactions, including esterification and amidation. The presence of the 3-aminophenyl group suggests potential applications in pharmaceuticals or as a building block in organic synthesis, particularly in the development of biologically active compounds. Additionally, the compound may exhibit interesting properties such as fluorescence or photostability, depending on its molecular structure and substituents. Overall, this compound's unique structural features make it a subject of interest in both synthetic and medicinal chemistry.
Formula:C12H11NO3
InChI:InChI=1S/C12H11NO3/c1-15-12(14)11-6-5-10(16-11)8-3-2-4-9(13)7-8/h2-7H,13H2,1H3
InChI key:IZIZPLREWPTKFV-UHFFFAOYSA-N
SMILES:COC(=O)C1=CC=C(O1)C2=CC(=CC=C2)N
Synonyms:
  • 5-(3-Aminophenyl)furan-2-carboxylicacid methyl ester
  • Methyl 5-(3-aminophenyl)-2-furancarboxylate
  • 5-(3-Aminophenyl)furan-2-carboxylic acid methyl ester
Found 2 products.