CymitQuimica logo

CAS 54024-10-1

:

(8S,10R,13S,17R)-17-ethynyl-17-hydroxy-13-methyl-11-methylene-2,6,7,8,9,10,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-3-one

Description:
The chemical substance with the name "(8S,10R,13S,17R)-17-ethynyl-17-hydroxy-13-methyl-11-methylene-2,6,7,8,9,10,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-3-one" and CAS number "54024-10-1" is a synthetic steroid compound. It features a complex polycyclic structure characteristic of steroids, with multiple chiral centers that contribute to its stereochemistry. The presence of an ethynyl group and a hydroxyl group indicates potential reactivity and biological activity, often associated with hormonal functions. This compound may exhibit properties similar to those of natural steroid hormones, influencing various physiological processes. Its unique structure allows for specific interactions with biological receptors, making it of interest in medicinal chemistry and pharmacology. Additionally, the compound's decahydro configuration suggests a saturated framework, which can affect its solubility and stability. Overall, this substance is significant in the study of steroid derivatives and their applications in therapeutic contexts.
Formula:C21H26O2
InChI:InChI=1/C21H26O2/c1-4-21(23)10-9-18-17-7-5-14-11-15(22)6-8-16(14)19(17)13(2)12-20(18,21)3/h1,11,16-19,23H,2,5-10,12H2,3H3/t16-,17-,18?,19?,20-,21-/m0/s1
SMILES:C#C[C@@]1(CCC2[C@@H]3CCC4=CC(=O)CC[C@@H]4C3C(=C)C[C@]12C)O
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 3 products.