CAS 54030-32-9
:4-Hydroxy-3-(hydroxymethyl)benzaldehyde
Description:
4-Hydroxy-3-(hydroxymethyl)benzaldehyde, also known as salicylaldehyde derivative, is an organic compound characterized by its aromatic structure featuring a hydroxymethyl group and a hydroxyl group attached to a benzaldehyde moiety. This compound typically appears as a white to light yellow crystalline solid and is soluble in polar solvents such as water, ethanol, and methanol due to the presence of hydroxyl groups that can engage in hydrogen bonding. It exhibits properties typical of aldehydes, including reactivity in condensation reactions and potential for oxidation. The hydroxyl groups contribute to its ability to act as a phenolic compound, which can participate in various chemical reactions, including nucleophilic substitutions and complexation with metal ions. Additionally, this compound may exhibit biological activity, making it of interest in medicinal chemistry and materials science. Its applications can range from use in organic synthesis to potential roles in pharmaceuticals and agrochemicals, depending on its reactivity and functional properties.
Formula:C8H8O3
InChI:InChI=1S/C8H8O3/c9-4-6-1-2-8(11)7(3-6)5-10/h1-4,10-11H,5H2
InChI key:InChIKey=SCXZNYRQOPBUTM-UHFFFAOYSA-N
SMILES:C(O)C1=CC(C=O)=CC=C1O
Synonyms:- 3-(Hydroxymethyl)-4-hydroxybenzaldehyde
- Benzaldehyde, 4-Hydroxy-3-(Hydroxymethyl)-
- 4-Hydroxy-3-(hydroxymethyl)benzaldehyde
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 10 products.
4-Hydroxy 3-Hydroxymethylbenzaldehyde (4-Hydroxy-3-(hydroxymethyl)benzaldehyde)
CAS:Aldehyde-ethers, aldehyde-phenols and aldehydes with other oxygen function, nesoiFormula:C8H8O3Color and Shape:White PowderMolecular weight:152.047344-Hydroxy-3-(hydroxymethyl)benzaldehyde
CAS:Formula:C8H8O3Purity:97%Color and Shape:SolidMolecular weight:152.14734-Hydroxy-3-(Hydroxymethyl)Benzaldehyde
CAS:4-Hydroxy-3-(Hydroxymethyl)BenzaldehydePurity:97%Molecular weight:152.15g/mol4-Hydroxy-3-(hydroxymethyl)benzaldehyde
CAS:4-Hydroxy-3-(hydroxymethyl)benzaldehyde is an aldehyde that belongs to the group of aromatic compounds. It is soluble in alcohols and insoluble in water. It reacts with formic acid to form the corresponding carboxylic acid, which may be converted into a variety of derivatives by reactions with other reagents. The enzyme preparations are used for the conversion of fats, oils, and grease (FOG) into biodiesel fuel. 4-Hydoxy-3-(hydroxymethyl)benzaldehyde has been shown to have an activation energy of 156 kJ mol-1. This value indicates that its reaction rate will be slow at low temperatures and high at high temperatures.Formula:C8H8O3Purity:Min. 95%Color and Shape:PowderMolecular weight:152.15 g/mol4-Hydroxy-3-(hydroxymethyl)benzaldehyde
CAS:Controlled ProductFormula:C8H8O3Color and Shape:NeatMolecular weight:152.15










