CAS 5404-88-6

2-chloro-6-hydrazinyl-5H-purine

Description:

2-Chloro-6-hydrazinyl-5H-purine, with the CAS number 5404-88-6, is a purine derivative characterized by the presence of a chlorine atom and a hydrazine functional group. This compound features a bicyclic structure typical of purines, which includes a fused imidazole and pyrimidine ring system. The chlorine substituent is located at the 2-position, while the hydrazinyl group is attached at the 6-position, influencing its reactivity and biological activity. This compound is of interest in medicinal chemistry, particularly for its potential applications in the development of antiviral and anticancer agents. Its hydrazinyl group can participate in various chemical reactions, including hydrazone formation and redox reactions. Additionally, the presence of the chlorine atom may enhance its lipophilicity and biological interactions. As with many nitrogen-containing heterocycles, 2-chloro-6-hydrazinyl-5H-purine may exhibit unique pharmacological properties, making it a subject of research in drug development and synthetic chemistry.

Formula: C₅H₅ClN₆

InChI: InChI=1/C5H5ClN6/c6-5-10-3-2(8-1-9-3)4(11-5)12-7/h1-2H,7H2,(H,8,9,10,11,12)

2 - Chloro - 6 - hydrazino - 7H - purine

CAS: 5404-88-6

Formula: C₅H₅ClN₆

Purity: 95%

Molecular weight: 184.5864

Ref: IN-DA00DL81

2-Chloro-6-hydrazino-9H-purine

CAS: 5404-88-6

2-Chloro-6-hydrazino-9H-purine

Purity: 95%

Molecular weight: 184.59g/mol

Ref: 54-OR1004212