
CAS 54045-74-8
:Methyl 2-bromothiazole-5-carboxylate
Description:
Methyl 2-bromothiazole-5-carboxylate is a chemical compound characterized by its thiazole ring, which is a five-membered heterocyclic structure containing both sulfur and nitrogen atoms. This compound features a bromine atom at the 2-position of the thiazole ring and a carboxylate group at the 5-position, with a methyl ester functional group. It is typically a colorless to pale yellow liquid or solid, depending on its purity and form. The presence of the bromine atom contributes to its reactivity, making it useful in various organic synthesis applications, particularly in the development of pharmaceuticals and agrochemicals. Methyl 2-bromothiazole-5-carboxylate is known for its potential biological activities, including antimicrobial and antifungal properties. Its solubility in organic solvents and moderate stability under standard conditions make it a valuable intermediate in chemical synthesis. As with many halogenated compounds, appropriate safety measures should be taken when handling this substance due to its potential toxicity and environmental impact.
Formula:C5H4BrNO2S
InChI:InChI=1/C5H4BrNO2S/c1-3(8)9-4-2-7-5(6)10-4/h2H,1H3
SMILES:CC(=O)Oc1cnc(Br)s1
Synonyms:- 5-Thiazolecarboxylic acid, 2-bromo-, methyl ester
- Methyl 2-bromo-1,3-thiazole-5-carboxylate
- Methyl 2-bromo-thiazole-5-carboxylate
- (2-Bromothiazol-5-Yl) Acetate
- Methyl 2-Bromo-5-Thiazole Carboxylate
Sort by
Found 4 products.
Methyl 2-bromo-1,3-thiazole-5-carboxylate
CAS:Methyl 2-bromo-1,3-thiazole-5-carboxylateFormula:C5H4BrNO2SPurity:97+%Color and Shape: yellow solidMolecular weight:222.06g/molRef: 54-OR10539
1g32.00€5g36.00€25g74.00€100g261.00€500g1,169.00€Methyl 2-bromothiazole-5-carboxylate
CAS:Formula:C5H4BrNO2SPurity:95%Color and Shape:SolidMolecular weight:222.06Ref: 10-F016168
1g12.00€5g16.00€10g25.00€25g58.00€100g205.00€500g900.00€Methyl 2-Bromothiazole-5-carboxylate
CAS:Formula:C5H4BrNO2SPurity:>95.0%(GC)Color and Shape:White to Yellow to Orange powder to crystalMolecular weight:222.06Ref: 3B-M2669
1g33.00€5g88.00€Methyl 2-bromothiazole-5-carboxylate
CAS:Formula:C5H4BrNO2SPurity:97%Color and Shape:SolidMolecular weight:222.0598Ref: IN-DA003RN6
1g21.00€5g31.00€10g46.00€25g71.00€100g211.00€