CymitQuimica logo

CAS 54045-76-0

:

2-Bromo-5-thiazolecarboxylic acid

Description:
2-Bromo-5-thiazolecarboxylic acid is an organic compound characterized by the presence of a thiazole ring, a carboxylic acid functional group, and a bromine atom. Its molecular structure features a five-membered heterocyclic ring containing both sulfur and nitrogen, which contributes to its unique chemical properties. The bromine substituent at the second position of the thiazole ring enhances its reactivity, making it useful in various chemical syntheses and applications. This compound is typically a white to off-white solid and is soluble in polar solvents, reflecting its acidic nature due to the carboxylic acid group. It may exhibit biological activity, making it of interest in pharmaceutical research and development. Additionally, the presence of the thiazole moiety can impart specific electronic properties, influencing its behavior in chemical reactions. Safety data should be consulted for handling, as with many halogenated compounds, it may pose health risks if not managed properly.
Formula:C4HBrNO2S
InChI:InChI=1/C4H2BrNO2S/c5-4-6-1-2(9-4)3(7)8/h1H,(H,7,8)/p-1
InChI key:BESGTWHUMYHYEQ-UHFFFAOYSA-N
SMILES:c1c(C(=O)[O-])sc(Br)n1
Synonyms:
  • 2-Bromo-1,3-Thiazole-5-Carboxylic Acid
  • 2-Bromo-1,3-Thiazole-5-Carboxylate
  • 2-Bromo-thiazole-5-carboxylic acid
Found 6 products.