CAS 54055-40-2

2-(5-methyl-1H-pyrazol-3-yl)ethanamine

Description:

2-(5-methyl-1H-pyrazol-3-yl)ethanamine, with the CAS number 54055-40-2, is an organic compound characterized by its pyrazole ring structure, which contributes to its unique chemical properties. This compound features an ethylamine side chain, making it a primary amine. The presence of the methyl group on the pyrazole ring enhances its lipophilicity, potentially influencing its biological activity and solubility in organic solvents. It is typically a colorless to light yellow liquid or solid, depending on its purity and form. The compound may exhibit basic properties due to the amine functional group, allowing it to participate in various chemical reactions, including nucleophilic substitutions and coordination with metal ions. Its structure suggests potential applications in pharmaceuticals, agrochemicals, or as a building block in organic synthesis. However, specific safety and handling guidelines should be followed, as with all chemical substances, to mitigate any risks associated with its use.

Formula: C₆H₁₁N₃

InChI: InChI=1/C6H11N3/c1-5-4-6(2-3-7)9-8-5/h4H,2-3,7H2,1H3,(H,8,9)

SMILES: Cc1cc(CCN)n[nH]1

Synonyms:

• 1H-pyrazole-5-ethanamine, 3-methyl-
• 2-(3-Methyl-1H-pyrazol-5-yl)ethanamine

2-(3-Methyl-1H-pyrazol-5-yl)ethanamine

CAS: 54055-40-2

Formula: C₆H₁₁N₃

Purity: 95.0%

Color and Shape: Solid, No data available.

Molecular weight: 125.175

Ref: 10-F431347