CAS 5406-21-3

2-[(3-chlorophenyl)carbamoyl]benzoic acid

Description:

2-[(3-Chlorophenyl)carbamoyl]benzoic acid, with the CAS number 5406-21-3, is an organic compound characterized by its structure, which includes a benzoic acid moiety substituted with a carbamoyl group and a 3-chlorophenyl group. This compound typically appears as a solid and is known for its potential applications in pharmaceuticals and agrochemicals due to its biological activity. The presence of the chlorophenyl group may enhance its lipophilicity, influencing its interaction with biological systems. The carboxylic acid functional group contributes to its acidity and potential for forming salts or esters. Additionally, the compound may exhibit properties such as solubility in organic solvents and varying degrees of solubility in water, depending on the pH. Its chemical behavior can be influenced by the presence of the chlorine atom, which can affect reactivity and stability. Overall, 2-[(3-chlorophenyl)carbamoyl]benzoic acid is of interest for further research in medicinal chemistry and related fields.

Formula: C₁₄H₁₀ClNO₃

InChI: InChI=1/C14H10ClNO3/c15-9-4-3-5-10(8-9)16-13(17)11-6-1-2-7-12(11)14(18)19/h1-8H,(H,16,17)(H,18,19)

SMILES: c1ccc(c(c1)C(=Nc1cccc(c1)Cl)O)C(=O)O

Synonyms:

• Benzoic Acid, 2-[[(3-Chlorophenyl)Amino]Carbonyl]-

2-(3-Chlorophenylcarbamoyl)benzoic acid

CAS: 5406-21-3

Formula: C₁₄H₁₀ClNO₃

Molecular weight: 275.6871

Ref: IN-DA00DITQ

N-(3-Chloro-phenyl)-phthalamic acid

CAS: 5406-21-3

Formula: C₁₄H₁₀ClNO₃

Purity: 95.0%

Molecular weight: 275.69

Ref: 10-F511640