CAS 5406-65-5: ethyl 5-(chloromethyl)-2-oxotetrahydrofuran-3-carboxylate

Description:Ethyl 5-(chloromethyl)-2-oxotetrahydrofuran-3-carboxylate, with the CAS number 5406-65-5, is a chemical compound characterized by its unique structure that includes a tetrahydrofuran ring, a carboxylate group, and a chloromethyl substituent. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. It is known for its reactivity due to the presence of the chloromethyl group, which can participate in nucleophilic substitution reactions. The oxo group contributes to its potential as a precursor in organic synthesis, particularly in the formation of various derivatives. Ethyl 5-(chloromethyl)-2-oxotetrahydrofuran-3-carboxylate may be utilized in the synthesis of pharmaceuticals, agrochemicals, and other fine chemicals, owing to its functional groups that allow for further chemical modifications. Safety data should be consulted for handling, as it may pose health risks if not managed properly.

Formula:C₈H₁₁ClO₄

InChI:InChI=1/C8H11ClO4/c1-2-12-7(10)6-3-5(4-9)13-8(6)11/h5-6H,2-4H2,1H3