CAS 5407-46-5
:2,6,7-Trihydroxy-9-methyl-3H-xanthen-3-one
Description:
2,6,7-Trihydroxy-9-methyl-3H-xanthen-3-one, commonly known as a xanthone, is a chemical compound characterized by its polyphenolic structure, which includes multiple hydroxyl groups. This compound typically exhibits a yellow to orange color, which is characteristic of many xanthones. It is soluble in organic solvents and has limited solubility in water, reflecting its hydrophobic nature due to the aromatic rings present in its structure. The presence of hydroxyl groups contributes to its potential antioxidant properties, making it of interest in various biological and pharmaceutical applications. Additionally, xanthones are known for their diverse biological activities, including anti-inflammatory, antimicrobial, and anticancer effects. The compound's molecular structure allows for various interactions with biological systems, which can be explored for therapeutic uses. Overall, 2,6,7-Trihydroxy-9-methyl-3H-xanthen-3-one represents a significant class of compounds with potential applications in health and medicine.
Formula:C14H10O5
InChI:InChI=1S/C14H10O5/c1-6-7-2-9(15)11(17)4-13(7)19-14-5-12(18)10(16)3-8(6)14/h2-5,15-17H,1H3
InChI key:InChIKey=TZVNNUHRZXQCHM-UHFFFAOYSA-N
SMILES:CC1=C2C(OC=3C1=CC(O)=C(O)C3)=CC(=O)C(O)=C2
Synonyms:- 2,6,7-Trihydroxy-9-Methylxanthen-3-One
- 2,6,7-trihydroxy-9-methyl-3H-xanthen-3-one
- 3H-Xanthen-3-one, 2,6,7-trihydroxy-9-methyl-
- 9-Methyl-2,3,7-trihydroxy-6-fluorone sulphate
- Methylfluorone
- NSC 5426
- NSC 66209
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
9-Methyl-2,3,7-trihydroxy-6-fluorone
CAS:<p>9-Methyl-2,3,7-trihydroxy-6-fluorone (9MHF) is a natural compound found in honeybee propolis. It has been shown to have anticancer activity against a range of tumour types. 9MHF inhibits the replication of DNA by binding to single-stranded regions in the DNA molecule and preventing the formation of double helices. The optimum concentration for 9MHF is 0.1 μM. At this concentration, it was found that 9MHF had chemoresistance properties and could inhibit replication in staphylococcus cells at concentrations as low as 1 μM. This compound also has antioxidant properties, with redox potentials of -0.09 V and -0.06 V for its oxidized and reduced forms respectively.BR>BR><br>9MHF is an inhibitor that binds to basic dyes such as methylene blue or gentian violet and prevents them from binding to the bacterial cell</p>Formula:C14H10O5Purity:Min. 95%Color and Shape:Yellow PowderMolecular weight:258.23 g/mol

