CymitQuimica logo

CAS 54076-73-2

:

[2-(bicyclo[2.2.1]hept-5-en-2-yl)ethyl](trichloro)silane

Description:
[2-(Bicyclo[2.2.1]hept-5-en-2-yl)ethyl](trichloro)silane, with the CAS number 54076-73-2, is an organosilicon compound characterized by the presence of a trichlorosilane functional group attached to a bicyclic structure. This compound features a bicyclo[2.2.1]heptene moiety, which contributes to its unique reactivity and steric properties. The trichlorosilane group is known for its ability to react with various substrates, making it useful in surface modification and as a coupling agent in polymer chemistry. The compound is typically a colorless to pale yellow liquid, exhibiting moderate volatility and a distinctive odor. Its reactivity is influenced by the presence of chlorine atoms, which can undergo hydrolysis in the presence of moisture, leading to the formation of silanol groups. This property makes it valuable in applications such as adhesion promotion and as a precursor for silicon-based materials. Safety precautions are necessary when handling this compound due to its potential irritant effects and reactivity with water.
Formula:C9H13Cl3Si
InChI:InChI=1/C9H13Cl3Si/c10-13(11,12)4-3-9-6-7-1-2-8(9)5-7/h1-2,7-9H,3-6H2
SMILES:C1=CC2CC1CC2CC[Si](Cl)(Cl)Cl
Synonyms:
  • Bicyclo[2.2.1]hept-2-ene, 5-[2-(trichlorosilyl)ethyl]-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.