CAS 54081-48-0
:Isoastilbin
Description:
Isoastilbin, with the CAS number 54081-48-0, is a naturally occurring flavonoid compound primarily derived from various plant sources. It is characterized by its polyphenolic structure, which contributes to its antioxidant properties. Isoastilbin exhibits a range of biological activities, including anti-inflammatory, antimicrobial, and potential anticancer effects, making it of interest in pharmacological research. The compound is soluble in organic solvents and has limited solubility in water, which can influence its bioavailability and efficacy in biological systems. Isoastilbin's chemical structure includes multiple hydroxyl groups, enhancing its reactivity and interaction with biological macromolecules. Additionally, its stability can be affected by environmental factors such as light and pH, which is crucial for its application in food and pharmaceutical industries. Overall, isoastilbin represents a significant area of study due to its potential health benefits and applications in natural product chemistry.
Formula:C21H22O11
InChI:InChI=1S/C21H22O11/c1-7-15(26)17(28)18(29)21(30-7)32-20-16(27)14-12(25)5-9(22)6-13(14)31-19(20)8-2-3-10(23)11(24)4-8/h2-7,15,17-26,28-29H,1H3/t7-,15-,17+,18+,19+,20+,21-/m0/s1
InChI key:InChIKey=ZROGCCBNZBKLEL-OOHAXVOVSA-N
SMILES:O([C@H]1[C@H](OC=2C(C1=O)=C(O)C=C(O)C2)C3=CC(O)=C(O)C=C3)[C@H]4[C@H](O)[C@H](O)[C@@H](O)[C@H](C)O4
Synonyms:- 4H-1-Benzopyran-4-one, 3-[(6-deoxy-α-L-mannopyranosyl)oxy]-2-(3,4-dihydroxyphenyl)-2,3-dihydro-5,7-dihydroxy-, (2R-cis)-
- 4H-1-Benzopyran-4-one, 3-[(6-deoxy-α-L-mannopyranosyl)oxy]-2-(3,4-dihydroxyphenyl)-2,3-dihydro-5,7-dihydroxy-, (2R,3S)-
- Isoastilbin
- (2R,3S)-Astilbin
- (2R,3S)-3-[(6-Deoxy-α-L-mannopyranosyl)oxy]-2-(3,4-dihydroxyphenyl)-2,3-dihydro-5,7-dihydroxy-4H-1-benzopyran-4-one
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
Isoastilbin
CAS:Isoastilbin is a dihydroflavonol glycoside compound in Rhizoma Smilacis glabrae and Astragalus membranaceus.Formula:C21H22O11Purity:99.54% - 99.95%Color and Shape:SolidMolecular weight:450.39Ref: TM-TN1772
1mg105.00€2mg157.00€5mg260.00€10mg385.00€25mg628.00€50mg872.00€100mg1,153.00€1mL*10mM (DMSO)295.00€Isoastilbin
CAS:Isoastilbin is a bioactive flavonoid, which is a naturally occurring compound found primarily in certain plant species, such as the Chinese herb Smilax glabra and Engelhardtia roxburghiana Wall leaf. As a derivative of astilbin, it possesses a unique mechanism that involves the modulation of cellular redox states. Isoastilbin's mode of action is primarily through its antioxidant properties, where it scavenges free radicals and thus, mitigates oxidative stress at a cellular level. Additionally, it exhibits anti-inflammatory effects by inhibiting the production of pro-inflammatory cytokines.The applications of Isoastilbin are diverse and promising in scientific research. It is extensively studied for its potential therapeutic benefits in combating diseases associated with oxidative stress and inflammation, such as cardiovascular diseases, neurodegenerative disorders, and certain metabolic syndromes. Furthermore, its role in cell signaling and apoptosis makes it a candidate for cancer research, offering insights into the molecular pathways that can be targeted for therapeutic intervention. Isoastilbin’s multifunctional properties make it a compelling subject for ongoing pharmacological and biomedical research.Formula:C21H22O11Purity:Min. 95%Color and Shape:PowderMolecular weight:450.39 g/mol





