CAS 5409-31-4
:3,4-Diethoxybenzoic acid
Description:
3,4-Diethoxybenzoic acid is an aromatic carboxylic acid characterized by the presence of two ethoxy groups attached to the benzene ring at the 3 and 4 positions relative to the carboxylic acid functional group. This compound typically appears as a white to off-white solid and is soluble in organic solvents such as ethanol and ether, but has limited solubility in water due to its hydrophobic ethoxy substituents. The presence of the carboxylic acid group imparts acidic properties, allowing it to participate in various chemical reactions, including esterification and amidation. Its structure contributes to its potential applications in organic synthesis, pharmaceuticals, and as a building block in the development of more complex molecules. Additionally, the compound may exhibit specific biological activities, making it of interest in medicinal chemistry. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper laboratory practices.
Formula:C11H14O4
InChI:InChI=1S/C11H14O4/c1-3-14-9-6-5-8(11(12)13)7-10(9)15-4-2/h5-7H,3-4H2,1-2H3,(H,12,13)
InChI key:InChIKey=VVKCVAPLTRZJHH-UHFFFAOYSA-N
SMILES:O(CC)C1=C(OCC)C=CC(C(O)=O)=C1
Synonyms:- 3,4-Bis(ethyloxy)benzoic acid
- 3,4-Diethoxybenzoate
- Benzoic Acid, 3,4-Diethoxy-
- NSC 10903
- NSC 8515
- 3,4-Diethoxybenzoic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
3,4-Diethoxybenzoic acid
CAS:Formula:C11H14O4Purity:97%Color and Shape:SolidMolecular weight:210.22653,4-Diethoxybenzoic Acid
CAS:Formula:C11H14O4Purity:>98.0%(GC)(T)Color and Shape:White to Almost white powder to crystalMolecular weight:210.233,4-Diethoxybenzoic acid
CAS:3,4-Diethoxybenzoic acid is a phenolic compound that has potent antitumor activity. It inhibits the growth of tumor cells by inhibiting DNA synthesis and protein synthesis in the cell. 3,4-Diethoxybenzoic acid also inhibits the production of enzymes such as pepsin, lipase, and amylase that are important for digestion. It has been shown to be an effective antifungal agent in vitro against Candida albicans and Saccharomyces cerevisiae. 3,4-Diethoxybenzoic acid may also have a role in the prevention of dental caries due to its inhibitory effects on bacterial plaque formation.
Formula:C11H14O4Purity:Min. 95%Color and Shape:Clear LiquidMolecular weight:210.23 g/mol




