CymitQuimica logo

CAS 5409-66-5

:

(4-hydroxy-1-methyl-4-phenylpiperidin-3-yl)(phenyl)methanone

Description:
The chemical substance known as (4-hydroxy-1-methyl-4-phenylpiperidin-3-yl)(phenyl)methanone, with the CAS number 5409-66-5, is a piperidine derivative that exhibits both structural and functional characteristics typical of compounds in this class. It features a piperidine ring substituted with a hydroxyl group and a phenyl group, contributing to its potential biological activity. The presence of the ketone functional group (methanone) indicates that it may participate in various chemical reactions, such as nucleophilic attacks or condensation reactions. This compound may exhibit psychoactive properties, as many piperidine derivatives are known to interact with neurotransmitter systems. Its solubility, stability, and reactivity can vary based on the specific conditions, such as pH and solvent used. Additionally, the compound's molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting neurological disorders. However, detailed studies on its pharmacokinetics, toxicity, and therapeutic efficacy would be necessary to fully understand its potential uses.
Formula:C19H21NO2
InChI:InChI=1/C19H21NO2/c1-20-13-12-19(22,16-10-6-3-7-11-16)17(14-20)18(21)15-8-4-2-5-9-15/h2-11,17,22H,12-14H2,1H3
SMILES:CN1CCC(c2ccccc2)(C(C1)C(=O)c1ccccc1)O
Synonyms:
  • Methanone, (4-hydroxy-1-methyl-4-phenyl-3-piperidinyl)phenyl-
  • (4-Hydroxy-1-methyl-4-phenylpiperidin-3-yl)(phenyl)methanone
  • (4-hydroxy-1-methyl-4-phenylpiperidin-3-yl)-phenylmethanone
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.