CAS 5409-83-6
:2,8-Dichlorodibenzofuran
Description:
2,8-Dichlorodibenzofuran is an organic compound characterized by its structure, which consists of two benzene rings fused to a furan ring, with chlorine substituents at the 2 and 8 positions of the dibenzofuran framework. This compound is typically a white to light yellow solid and is known for its stability and resistance to degradation. It is relatively insoluble in water but soluble in organic solvents, which makes it relevant in various chemical applications. 2,8-Dichlorodibenzofuran is of interest in environmental chemistry due to its potential presence as a pollutant and its implications in toxicology, particularly concerning its persistence in the environment and bioaccumulation in living organisms. The compound may exhibit biological activity, and its chlorinated structure suggests potential interactions with biological systems, warranting further investigation into its environmental impact and health effects. Safety data should be consulted for handling and exposure guidelines, as chlorinated compounds can pose risks to human health and the environment.
Formula:C12H6Cl2O
InChI:InChI=1/C12H6Cl2O/c13-7-1-3-11-9(5-7)10-6-8(14)2-4-12(10)15-11/h1-6H
InChI key:InChIKey=IVVRJIDVYSPKFZ-UHFFFAOYSA-N
SMILES:ClC=1C=C2C=3C(OC2=CC1)=CC=C(Cl)C3
Synonyms:- 2,8-Dichlordibenzofuran
- 2,8-Dichlorodibenzofuran
- Dibenzofuran, 2,8-Dichloro-
- NSC 12535
- Pcdf 16
- 2,8-Dichlorodibenzo[b,d]furan
- 2,8-DichlorodibenzofuranQ: What is
- 2,8-DICHLORODIBENZOFURAN (50 UG/ML IN ISOOCTANE)
- 2,8-Dichlorodibenzofuran@50 μg/mL in Isooctane
- 2,8-Dichlorodibenzofuran Q: What is the CAS Number of
- Triclosan Impurity 5
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 3 products.
2,8-Dichlorodibenzo[b,d]furan
CAS:Controlled ProductFormula:C12H6Cl2OColor and Shape:NeatMolecular weight:231.51


