CAS 54090-25-4

N-(4-hydroxyphenyl)-2-methoxybenzamide

Description:

N-(4-hydroxyphenyl)-2-methoxybenzamide, also known by its CAS number 54090-25-4, is an organic compound characterized by its amide functional group, which is derived from the reaction of an amine and a carboxylic acid. This compound features a hydroxyphenyl group and a methoxybenzamide structure, contributing to its potential biological activity. It is typically a solid at room temperature and may exhibit moderate solubility in organic solvents, depending on the specific conditions. The presence of the hydroxy and methoxy groups can influence its reactivity and interactions with other molecules, making it of interest in various fields, including medicinal chemistry and materials science. Additionally, compounds like this may exhibit antioxidant properties or serve as intermediates in the synthesis of more complex molecules. Safety data should be consulted for handling and usage, as with any chemical substance, to ensure proper precautions are taken.

Formula: C₁₄H₁₃NO₃

InChI: InChI=1/C14H13NO3/c1-18-13-5-3-2-4-12(13)14(17)15-10-6-8-11(16)9-7-10/h2-9,16H,1H3,(H,15,17)

SMILES: COc1ccccc1C(=O)Nc1ccc(cc1)O

Synonyms:

• benzamide, N-(4-hydroxyphenyl)-2-methoxy-

N-(4-Hydroxyphenyl)-2-methoxybenzamide

CAS: 54090-25-4

Versatile small molecule scaffold

Formula: C₁₄H₁₃NO₃

Purity: Min. 95%

Molecular weight: 243.26 g/mol

Ref: 3D-ECA09025