CAS 54090-40-3

4-(chlorosulfonyl)-2-nitrobenzoic acid

Description:

4-(Chlorosulfonyl)-2-nitrobenzoic acid, with the CAS number 54090-40-3, is an organic compound characterized by the presence of both a nitro group and a chlorosulfonyl group attached to a benzoic acid structure. This compound typically appears as a solid and is known for its reactivity due to the presence of the chlorosulfonyl group, which can act as a sulfonylating agent in various chemical reactions. The nitro group contributes to its electrophilic properties, making it useful in synthetic organic chemistry. It is often utilized in the synthesis of pharmaceuticals and agrochemicals, as well as in the development of dyes and other specialty chemicals. The compound is soluble in polar solvents, and its reactivity can be influenced by the pH of the environment. Safety precautions should be taken when handling this substance, as it may pose health risks due to its corrosive and potentially toxic nature. Proper storage and disposal methods are essential to mitigate any environmental impact.

Formula: C₇H₄ClNO₆S

InChI: InChI=1/C7H4ClNO6S/c8-16(14,15)4-1-2-5(7(10)11)6(3-4)9(12)13/h1-3H,(H,10,11)

SMILES: c1cc(c(cc1S(=O)(=O)Cl)N(=O)=O)C(=O)O

4-(Chlorosulfonyl)-2-nitrobenzoic Acid

Controlled Product

CAS: 54090-40-3

Formula: C₇H₄ClNO₆S

Color and Shape: Neat

Molecular weight: 265.62

Ref: TR-C383900