CAS 54091-06-4

1-bromo-4-[(chloromethyl)sulfonyl]benzene

Description:

1-Bromo-4-[(chloromethyl)sulfonyl]benzene, with the CAS number 54091-06-4, is an organic compound characterized by the presence of a bromine atom and a chloromethylsulfonyl group attached to a benzene ring. This compound features a sulfonyl functional group, which is known for its strong electron-withdrawing properties, enhancing the reactivity of the aromatic system. The bromine substituent can participate in nucleophilic substitution reactions, while the chloromethyl group can serve as a leaving group in various chemical transformations. The presence of both halogen atoms (bromine and chlorine) suggests potential applications in synthetic organic chemistry, particularly in the development of pharmaceuticals or agrochemicals. Additionally, the compound's structure indicates it may exhibit specific physical properties such as solubility in organic solvents and potential reactivity under certain conditions. Safety considerations should be taken into account due to the presence of halogens and the sulfonyl group, which may pose hazards in handling and disposal.

Formula: C₁₄H₁₀Br₂Cl₂O₂S

InChI: InChI=1/C14H10Br2Cl2O2S/c15-11-5-1-9(2-6-11)13(17)21(19,20)14(18)10-3-7-12(16)8-4-10/h1-8,13-14H

SMILES: c1cc(ccc1C(Cl)S(=O)(=O)C(c1ccc(cc1)Br)Cl)Br

Synonyms:

• Benzene, 1-bromo-4-((chloromethyl)sulfonyl)-

4-bromophenylchloromethyl sulfone

CAS: 54091-06-4

Formula: C₇H₆BrClO₂S

Purity: 95%

Molecular weight: 269.5433

Ref: IN-DA00DQTV

1-Bromo-4-(chloromethylsulfonyl)benzene

CAS: 54091-06-4

1-Bromo-4-(chloromethylsulfonyl)benzene

Purity: 95%

Molecular weight: 269.55g/mol

Ref: 54-OR97144

1-Bromo-4-((chloromethyl)sulfonyl)benzene

CAS: 54091-06-4

1-Bromo-4-(chloromethyl)sulfonylbenzene is a chemical compound that is used as an agrochemical. It is insoluble in water, but soluble in organic solvents such as acetone and ethanol. Its stability to heat and acids make it suitable for use in pesticides. This chemical can be used as an excipient with other chemicals to form granules. 1-Bromo-4-(chloromethyl)sulfonylbenzene has been shown to have matrix effects on the growth of microorganisms, which may be due to its ability to alter the nutrient availability or the physicochemical environment of the cell.

Formula: C₇H₆BrClO₂S

Purity: Min. 95%

Molecular weight: 269.54 g/mol

Ref: 3D-ECA09106